C17H24BF3O2 — CID 162614699
4,4,5-trimethyl-5-propan-2-yl-2-[1-[4-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]ethenyl]-1,3,2-dioxaborolane (PubChem CID 162614699) has the molecular formula C17H24BF3O2 and a molecular weight of 328.18 g/mol. Its IUPAC name is 4,4,5-trimethyl-5-propan-2-yl-2-[1-[4-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]ethenyl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5-trimethyl-5-propan-2-yl-2-[1-[4-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]ethenyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 162614699 |
| Molecular Formula | C17H24BF3O2 |
| Molecular Weight | 328.18 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | 4,4,5-trimethyl-5-propan-2-yl-2-[1-[4-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]ethenyl]-1,3,2-dioxaborolane |
| SMILES | C=C(B1OC(C)(C)C(C)(C(C)C)O1)C1=CC=C(C(F)(F)F)CC1 |
| InChI | InChI=1S/C17H24BF3O2/c1-11(2)16(6)15(4,5)22-18(23-16)12(3)13-7-9-14(10-8-13)17(19,20)21/h7,9,11H,3,8,10H2,1-2,4-6H3 |
| InChIKey | ZYAPAAUHNXPZFC-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.18 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|