About CID 162614832
CID 162614832 (PubChem CID 162614832) has the molecular formula C13H15F3N3O3S+
and a molecular weight of 350.34 g/mol.
Molecular Properties
| Compound Name | CID 162614832 |
| PubChem CID | 162614832 |
| Molecular Formula | C13H15F3N3O3S+ |
| Molecular Weight | 350.34 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | — |
| SMILES | CC[S+](=O)(O)c1cc(/N=C/C=C(N)C(F)(F)F)cnc1C(C)=O |
| InChI | InChI=1S/C13H14F3N3O3S/c1-3-23(21,22)10-6-9(7-19-12(10)8(2)20)18-5-4-11(17)13(14,15)16/h4-7H,3H2,1-2H3,(H2-,17,18,20,21,22)/p+1 |
| InChIKey | YFGCUSZSQGUEGT-UHFFFAOYSA-O |
| XLogP | 2.74 |
| TPSA | 105.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.34 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze CID 162614832 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 162614832?
The IUPAC name of CID 162614832 (CID 162614832) is not available.
What is the SMILES notation for CID 162614832?
The canonical SMILES for CID 162614832 is CC[S+](=O)(O)c1cc(/N=C/C=C(N)C(F)(F)F)cnc1C(C)=O.
What is the InChIKey of CID 162614832?
The InChIKey is YFGCUSZSQGUEGT-UHFFFAOYSA-O. The full InChI is InChI=1S/C13H14F3N3O3S/c1-3-23(21,22)10-6-9(7-19-12(10)8(2)20)18-5-4-11(17)13(14,15)16/h4-7H,3H2,1-2H3,(H2-,17,18,20,21,22)/p+1.
What are the key properties of CID 162614832?
CID 162614832 has a molecular weight of 350.34 g/mol, XLogP of 2.74, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 162614832 is sourced from PubChem (CID 162614832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).