C18H20ClF2N3O3 — CID 162615406
1-[[6-chloro-5-(1,1-difluoroprop-2-enyl)-2-pyridinyl]amino]-3-(3-hydroxypentyl)-4-methylpyrrole-2,5-dione (PubChem CID 162615406) has the molecular formula C18H20ClF2N3O3 and a molecular weight of 399.83 g/mol. Its IUPAC name is 1-[[6-chloro-5-(1,1-difluoroprop-2-enyl)-2-pyridinyl]amino]-3-(3-hydroxypentyl)-4-methylpyrrole-2,5-dione.
| Compound Name | 1-[[6-chloro-5-(1,1-difluoroprop-2-enyl)-2-pyridinyl]amino]-3-(3-hydroxypentyl)-4-methylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 162615406 |
| Molecular Formula | C18H20ClF2N3O3 |
| Molecular Weight | 399.83 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | 1-[[6-chloro-5-(1,1-difluoroprop-2-enyl)-2-pyridinyl]amino]-3-(3-hydroxypentyl)-4-methylpyrrole-2,5-dione |
| SMILES | C=CC(F)(F)c1ccc(NN2C(=O)C(C)=C(CCC(O)CC)C2=O)nc1Cl |
| InChI | InChI=1S/C18H20ClF2N3O3/c1-4-11(25)6-7-12-10(3)16(26)24(17(12)27)23-14-9-8-13(15(19)22-14)18(20,21)5-2/h5,8-9,11,25H,2,4,6-7H2,1,3H3,(H,22,23) |
| InChIKey | DUDFZFAQWIOLGY-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.83 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|