C29H37F5N8O — CID 162615675
[3-[7-(difluoromethyl)-6-(1-methylpyrazol-4-yl)-3,4-dihydro-2H-quinolin-1-yl]-1-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-5-yl]-(methylamino)methanol (PubChem CID 162615675) has the molecular formula C29H37F5N8O and a molecular weight of 608.66 g/mol. Its IUPAC name is [3-[7-(difluoromethyl)-6-(1-methylpyrazol-4-yl)-3,4-dihydro-2H-quinolin-1-yl]-1-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-5-yl]-(methylamino)methanol.
| Compound Name | [3-[7-(difluoromethyl)-6-(1-methylpyrazol-4-yl)-3,4-dihydro-2H-quinolin-1-yl]-1-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-5-yl]-(methylamino)methanol |
|---|---|
| PubChem CID | 162615675 |
| Molecular Formula | C29H37F5N8O |
| Molecular Weight | 608.66 g/mol |
| Exact Mass | 608.30 |
| IUPAC Name | [3-[7-(difluoromethyl)-6-(1-methylpyrazol-4-yl)-3,4-dihydro-2H-quinolin-1-yl]-1-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-5-yl]-(methylamino)methanol |
| SMILES | CNC(O)N1CCc2c(c(N3CCCc4cc(-c5cnn(C)c5)c(C(F)F)cc43)nn2C2CCN(CC(F)(F)F)CC2)C1 |
| InChI | InChI=1S/C29H37F5N8O/c1-35-28(43)40-11-7-24-23(16-40)27(37-42(24)20-5-9-39(10-6-20)17-29(32,33)34)41-8-3-4-18-12-21(19-14-36-38(2)15-19)22(26(30)31)13-25(18)41/h12-15,20,26,28,35,43H,3-11,16-17H2,1-2H3 |
| InChIKey | RARCEWGLULEKQT-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 77.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.66 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|