C22H26F3N7O5 — CID 162616508
6,22-diamino-3-methyl-14-(2,2,2-trifluoroacetyl)-11,17-dioxa-2,4,14-triazatricyclo[16.4.0.05,10]docosa-1(22),5,7,9,18,20-hexaene-8,20-dicarboxamide (PubChem CID 162616508) has the molecular formula C22H26F3N7O5 and a molecular weight of 525.49 g/mol. Its IUPAC name is 6,22-diamino-3-methyl-14-(2,2,2-trifluoroacetyl)-11,17-dioxa-2,4,14-triazatricyclo[16.4.0.05,10]docosa-1(22),5,7,9,18,20-hexaene-8,20-dicarboxamide.
| Compound Name | 6,22-diamino-3-methyl-14-(2,2,2-trifluoroacetyl)-11,17-dioxa-2,4,14-triazatricyclo[16.4.0.05,10]docosa-1(22),5,7,9,18,20-hexaene-8,20-dicarboxamide |
|---|---|
| PubChem CID | 162616508 |
| Molecular Formula | C22H26F3N7O5 |
| Molecular Weight | 525.49 g/mol |
| Exact Mass | 525.19 |
| IUPAC Name | 6,22-diamino-3-methyl-14-(2,2,2-trifluoroacetyl)-11,17-dioxa-2,4,14-triazatricyclo[16.4.0.05,10]docosa-1(22),5,7,9,18,20-hexaene-8,20-dicarboxamide |
| SMILES | CC1Nc2c(N)cc(C(N)=O)cc2OCCN(C(=O)C(F)(F)F)CCOc2cc(C(N)=O)cc(N)c2N1 |
| InChI | InChI=1S/C22H26F3N7O5/c1-10-30-17-13(26)6-11(19(28)33)8-15(17)36-4-2-32(21(35)22(23,24)25)3-5-37-16-9-12(20(29)34)7-14(27)18(16)31-10/h6-10,30-31H,2-5,26-27H2,1H3,(H2,28,33)(H2,29,34) |
| InChIKey | ULAZZVMXGODOAU-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 201.05 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.49 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|