About 6-chloro-5-(trifluoromethyl)-2,3-dihydropyridin-2-amine
6-chloro-5-(trifluoromethyl)-2,3-dihydropyridin-2-amine (PubChem CID 162616509) has the molecular formula C6H6ClF3N2
and a molecular weight of 198.58 g/mol. Its IUPAC name is 6-chloro-5-(trifluoromethyl)-2,3-dihydropyridin-2-amine.
Molecular Properties
| Compound Name | 6-chloro-5-(trifluoromethyl)-2,3-dihydropyridin-2-amine |
| PubChem CID | 162616509 |
| Molecular Formula | C6H6ClF3N2 |
| Molecular Weight | 198.58 g/mol |
| Exact Mass | 198.02 |
| IUPAC Name | 6-chloro-5-(trifluoromethyl)-2,3-dihydropyridin-2-amine |
| SMILES | NC1CC=C(C(F)(F)F)C(Cl)=N1 |
| InChI | InChI=1S/C6H6ClF3N2/c7-5-3(6(8,9)10)1-2-4(11)12-5/h1,4H,2,11H2 |
| InChIKey | YBNACMQYDLMTDL-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.58 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-chloro-5-(trifluoromethyl)-2,3-dihydropyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-5-(trifluoromethyl)-2,3-dihydropyridin-2-amine?
The IUPAC name of 6-chloro-5-(trifluoromethyl)-2,3-dihydropyridin-2-amine (CID 162616509) is 6-chloro-5-(trifluoromethyl)-2,3-dihydropyridin-2-amine.
What is the SMILES notation for 6-chloro-5-(trifluoromethyl)-2,3-dihydropyridin-2-amine?
The canonical SMILES for 6-chloro-5-(trifluoromethyl)-2,3-dihydropyridin-2-amine is NC1CC=C(C(F)(F)F)C(Cl)=N1.
What is the InChIKey of 6-chloro-5-(trifluoromethyl)-2,3-dihydropyridin-2-amine?
The InChIKey is YBNACMQYDLMTDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6ClF3N2/c7-5-3(6(8,9)10)1-2-4(11)12-5/h1,4H,2,11H2.
What are the key properties of 6-chloro-5-(trifluoromethyl)-2,3-dihydropyridin-2-amine?
6-chloro-5-(trifluoromethyl)-2,3-dihydropyridin-2-amine has a molecular weight of 198.58 g/mol, XLogP of 1.80, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-5-(trifluoromethyl)-2,3-dihydropyridin-2-amine is sourced from PubChem (CID 162616509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).