About 5,5-difluoro-2-imino-4,4-dimethylpentanoic acid
5,5-difluoro-2-imino-4,4-dimethylpentanoic acid (PubChem CID 162616599) has the molecular formula C7H11F2NO2
and a molecular weight of 179.17 g/mol. Its IUPAC name is 5,5-difluoro-2-imino-4,4-dimethylpentanoic acid.
Molecular Properties
| Compound Name | 5,5-difluoro-2-imino-4,4-dimethylpentanoic acid |
| PubChem CID | 162616599 |
| Molecular Formula | C7H11F2NO2 |
| Molecular Weight | 179.17 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | 5,5-difluoro-2-imino-4,4-dimethylpentanoic acid |
| SMILES | [H]/N=C(/CC(C)(C)C(F)F)C(=O)O |
| InChI | InChI=1S/C7H11F2NO2/c1-7(2,6(8)9)3-4(10)5(11)12/h6,10H,3H2,1-2H3,(H,11,12)/b10-4- |
| InChIKey | VHGNJQLWEWTBOS-WMZJFQQLSA-N |
| XLogP | 1.77 |
| TPSA | 61.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.17 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5,5-difluoro-2-imino-4,4-dimethylpentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-difluoro-2-imino-4,4-dimethylpentanoic acid?
The IUPAC name of 5,5-difluoro-2-imino-4,4-dimethylpentanoic acid (CID 162616599) is 5,5-difluoro-2-imino-4,4-dimethylpentanoic acid.
What is the SMILES notation for 5,5-difluoro-2-imino-4,4-dimethylpentanoic acid?
The canonical SMILES for 5,5-difluoro-2-imino-4,4-dimethylpentanoic acid is [H]/N=C(/CC(C)(C)C(F)F)C(=O)O.
What is the InChIKey of 5,5-difluoro-2-imino-4,4-dimethylpentanoic acid?
The InChIKey is VHGNJQLWEWTBOS-WMZJFQQLSA-N. The full InChI is InChI=1S/C7H11F2NO2/c1-7(2,6(8)9)3-4(10)5(11)12/h6,10H,3H2,1-2H3,(H,11,12)/b10-4-.
What are the key properties of 5,5-difluoro-2-imino-4,4-dimethylpentanoic acid?
5,5-difluoro-2-imino-4,4-dimethylpentanoic acid has a molecular weight of 179.17 g/mol, XLogP of 1.77, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-difluoro-2-imino-4,4-dimethylpentanoic acid is sourced from PubChem (CID 162616599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).