About N-but-1-en-2-yl-2,3-dimethyl-2-(trifluoromethyl)butan-1-amine
N-but-1-en-2-yl-2,3-dimethyl-2-(trifluoromethyl)butan-1-amine (PubChem CID 162616930) has the molecular formula C11H20F3N
and a molecular weight of 223.28 g/mol. Its IUPAC name is N-but-1-en-2-yl-2,3-dimethyl-2-(trifluoromethyl)butan-1-amine.
Molecular Properties
| Compound Name | N-but-1-en-2-yl-2,3-dimethyl-2-(trifluoromethyl)butan-1-amine |
| PubChem CID | 162616930 |
| Molecular Formula | C11H20F3N |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.15 |
| IUPAC Name | N-but-1-en-2-yl-2,3-dimethyl-2-(trifluoromethyl)butan-1-amine |
| SMILES | C=C(CC)NCC(C)(C(C)C)C(F)(F)F |
| InChI | InChI=1S/C11H20F3N/c1-6-9(4)15-7-10(5,8(2)3)11(12,13)14/h8,15H,4,6-7H2,1-3,5H3 |
| InChIKey | LBDYWBNYWFRMBH-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-but-1-en-2-yl-2,3-dimethyl-2-(trifluoromethyl)butan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-but-1-en-2-yl-2,3-dimethyl-2-(trifluoromethyl)butan-1-amine?
The IUPAC name of N-but-1-en-2-yl-2,3-dimethyl-2-(trifluoromethyl)butan-1-amine (CID 162616930) is N-but-1-en-2-yl-2,3-dimethyl-2-(trifluoromethyl)butan-1-amine.
What is the SMILES notation for N-but-1-en-2-yl-2,3-dimethyl-2-(trifluoromethyl)butan-1-amine?
The canonical SMILES for N-but-1-en-2-yl-2,3-dimethyl-2-(trifluoromethyl)butan-1-amine is C=C(CC)NCC(C)(C(C)C)C(F)(F)F.
What is the InChIKey of N-but-1-en-2-yl-2,3-dimethyl-2-(trifluoromethyl)butan-1-amine?
The InChIKey is LBDYWBNYWFRMBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20F3N/c1-6-9(4)15-7-10(5,8(2)3)11(12,13)14/h8,15H,4,6-7H2,1-3,5H3.
What are the key properties of N-but-1-en-2-yl-2,3-dimethyl-2-(trifluoromethyl)butan-1-amine?
N-but-1-en-2-yl-2,3-dimethyl-2-(trifluoromethyl)butan-1-amine has a molecular weight of 223.28 g/mol, XLogP of 3.72, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-but-1-en-2-yl-2,3-dimethyl-2-(trifluoromethyl)butan-1-amine is sourced from PubChem (CID 162616930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).