About 3-(1,1-difluoroethyl)-5-methyl-1-(trifluoromethyl)cyclohexa-1,3-diene
3-(1,1-difluoroethyl)-5-methyl-1-(trifluoromethyl)cyclohexa-1,3-diene (PubChem CID 162616932) has the molecular formula C10H11F5
and a molecular weight of 226.19 g/mol. Its IUPAC name is 3-(1,1-difluoroethyl)-5-methyl-1-(trifluoromethyl)cyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 3-(1,1-difluoroethyl)-5-methyl-1-(trifluoromethyl)cyclohexa-1,3-diene |
| PubChem CID | 162616932 |
| Molecular Formula | C10H11F5 |
| Molecular Weight | 226.19 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 3-(1,1-difluoroethyl)-5-methyl-1-(trifluoromethyl)cyclohexa-1,3-diene |
| SMILES | CC1C=C(C(C)(F)F)C=C(C(F)(F)F)C1 |
| InChI | InChI=1S/C10H11F5/c1-6-3-7(9(2,11)12)5-8(4-6)10(13,14)15/h3,5-6H,4H2,1-2H3 |
| InChIKey | FHTITNJBZOEMPT-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.19 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-(1,1-difluoroethyl)-5-methyl-1-(trifluoromethyl)cyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,1-difluoroethyl)-5-methyl-1-(trifluoromethyl)cyclohexa-1,3-diene?
The IUPAC name of 3-(1,1-difluoroethyl)-5-methyl-1-(trifluoromethyl)cyclohexa-1,3-diene (CID 162616932) is 3-(1,1-difluoroethyl)-5-methyl-1-(trifluoromethyl)cyclohexa-1,3-diene.
What is the SMILES notation for 3-(1,1-difluoroethyl)-5-methyl-1-(trifluoromethyl)cyclohexa-1,3-diene?
The canonical SMILES for 3-(1,1-difluoroethyl)-5-methyl-1-(trifluoromethyl)cyclohexa-1,3-diene is CC1C=C(C(C)(F)F)C=C(C(F)(F)F)C1.
What is the InChIKey of 3-(1,1-difluoroethyl)-5-methyl-1-(trifluoromethyl)cyclohexa-1,3-diene?
The InChIKey is FHTITNJBZOEMPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11F5/c1-6-3-7(9(2,11)12)5-8(4-6)10(13,14)15/h3,5-6H,4H2,1-2H3.
What are the key properties of 3-(1,1-difluoroethyl)-5-methyl-1-(trifluoromethyl)cyclohexa-1,3-diene?
3-(1,1-difluoroethyl)-5-methyl-1-(trifluoromethyl)cyclohexa-1,3-diene has a molecular weight of 226.19 g/mol, XLogP of 4.10, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,1-difluoroethyl)-5-methyl-1-(trifluoromethyl)cyclohexa-1,3-diene is sourced from PubChem (CID 162616932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).