C21H22F3NO4S — CID 162617606
(3,6,6,9-tetramethyl-11-oxo-7,8,9,10-tetrahydro-5H-benzo[b]carbazol-8-yl) trifluoromethanesulfonate (PubChem CID 162617606) has the molecular formula C21H22F3NO4S and a molecular weight of 441.47 g/mol. Its IUPAC name is (3,6,6,9-tetramethyl-11-oxo-7,8,9,10-tetrahydro-5H-benzo[b]carbazol-8-yl) trifluoromethanesulfonate.
| Compound Name | (3,6,6,9-tetramethyl-11-oxo-7,8,9,10-tetrahydro-5H-benzo[b]carbazol-8-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 162617606 |
| Molecular Formula | C21H22F3NO4S |
| Molecular Weight | 441.47 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | (3,6,6,9-tetramethyl-11-oxo-7,8,9,10-tetrahydro-5H-benzo[b]carbazol-8-yl) trifluoromethanesulfonate |
| SMILES | Cc1ccc2c3c([nH]c2c1)C(C)(C)C1=C(CC(C)C(OS(=O)(=O)C(F)(F)F)C1)C3=O |
| InChI | InChI=1S/C21H22F3NO4S/c1-10-5-6-12-15(7-10)25-19-17(12)18(26)13-8-11(2)16(9-14(13)20(19,3)4)29-30(27,28)21(22,23)24/h5-7,11,16,25H,8-9H2,1-4H3 |
| InChIKey | BUFFBGMREJMYPO-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 76.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.47 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|