C28H39F2N7O — CID 162618080
1-[3-[6-(1-amino-3-methyliminoprop-1-en-2-yl)-7-(difluoromethyl)-3,4-dihydro-2H-quinolin-1-yl]-2-methyl-1-piperidin-4-yl-3,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]ethanone (PubChem CID 162618080) has the molecular formula C28H39F2N7O and a molecular weight of 527.66 g/mol. Its IUPAC name is 1-[3-[6-(1-amino-3-methyliminoprop-1-en-2-yl)-7-(difluoromethyl)-3,4-dihydro-2H-quinolin-1-yl]-2-methyl-1-piperidin-4-yl-3,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]ethanone.
| Compound Name | 1-[3-[6-(1-amino-3-methyliminoprop-1-en-2-yl)-7-(difluoromethyl)-3,4-dihydro-2H-quinolin-1-yl]-2-methyl-1-piperidin-4-yl-3,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]ethanone |
|---|---|
| PubChem CID | 162618080 |
| Molecular Formula | C28H39F2N7O |
| Molecular Weight | 527.66 g/mol |
| Exact Mass | 527.32 |
| IUPAC Name | 1-[3-[6-(1-amino-3-methyliminoprop-1-en-2-yl)-7-(difluoromethyl)-3,4-dihydro-2H-quinolin-1-yl]-2-methyl-1-piperidin-4-yl-3,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]ethanone |
| SMILES | C/N=C/C(=CN)c1cc2c(cc1C(F)F)N(C1C3=C(CCN(C(C)=O)C3)N(C3CCNCC3)N1C)CCC2 |
| InChI | InChI=1S/C28H39F2N7O/c1-18(38)35-12-8-25-24(17-35)28(34(3)37(25)21-6-9-33-10-7-21)36-11-4-5-19-13-22(20(15-31)16-32-2)23(27(29)30)14-26(19)36/h13-16,21,27-28,33H,4-12,17,31H2,1-3H3/b20-15?,32-16+ |
| InChIKey | CBRSIWDHGYNAAQ-QJJNYAPHSA-N |
| XLogP | 3.12 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.66 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|