C18H15F3N4O3S — CID 162618429
1,1-dioxo-N-[3-[3-(trifluoromethoxy)phenyl]imidazo[1,2-b]pyridazin-6-yl]thian-4-imine (PubChem CID 162618429) has the molecular formula C18H15F3N4O3S and a molecular weight of 424.40 g/mol. Its IUPAC name is 1,1-dioxo-N-[3-[3-(trifluoromethoxy)phenyl]imidazo[1,2-b]pyridazin-6-yl]thian-4-imine.
| Compound Name | 1,1-dioxo-N-[3-[3-(trifluoromethoxy)phenyl]imidazo[1,2-b]pyridazin-6-yl]thian-4-imine |
|---|---|
| PubChem CID | 162618429 |
| Molecular Formula | C18H15F3N4O3S |
| Molecular Weight | 424.40 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | 1,1-dioxo-N-[3-[3-(trifluoromethoxy)phenyl]imidazo[1,2-b]pyridazin-6-yl]thian-4-imine |
| SMILES | O=S1(=O)CCC(=Nc2ccc3ncc(-c4cccc(OC(F)(F)F)c4)n3n2)CC1 |
| InChI | InChI=1S/C18H15F3N4O3S/c19-18(20,21)28-14-3-1-2-12(10-14)15-11-22-17-5-4-16(24-25(15)17)23-13-6-8-29(26,27)9-7-13/h1-5,10-11H,6-9H2 |
| InChIKey | FNECOKYQTSROCS-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 85.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.40 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|