About 2-methyl-3-propan-2-yl-5-(trifluoromethyl)-1,5-dihydropyrazole
2-methyl-3-propan-2-yl-5-(trifluoromethyl)-1,5-dihydropyrazole (PubChem CID 162618946) has the molecular formula C8H13F3N2
and a molecular weight of 194.20 g/mol. Its IUPAC name is 2-methyl-3-propan-2-yl-5-(trifluoromethyl)-1,5-dihydropyrazole.
Molecular Properties
| Compound Name | 2-methyl-3-propan-2-yl-5-(trifluoromethyl)-1,5-dihydropyrazole |
| PubChem CID | 162618946 |
| Molecular Formula | C8H13F3N2 |
| Molecular Weight | 194.20 g/mol |
| Exact Mass | 194.10 |
| IUPAC Name | 2-methyl-3-propan-2-yl-5-(trifluoromethyl)-1,5-dihydropyrazole |
| SMILES | CC(C)C1=CC(C(F)(F)F)NN1C |
| InChI | InChI=1S/C8H13F3N2/c1-5(2)6-4-7(8(9,10)11)12-13(6)3/h4-5,7,12H,1-3H3 |
| InChIKey | WEDNDBBHEMKVAM-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.20 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-3-propan-2-yl-5-(trifluoromethyl)-1,5-dihydropyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3-propan-2-yl-5-(trifluoromethyl)-1,5-dihydropyrazole?
The IUPAC name of 2-methyl-3-propan-2-yl-5-(trifluoromethyl)-1,5-dihydropyrazole (CID 162618946) is 2-methyl-3-propan-2-yl-5-(trifluoromethyl)-1,5-dihydropyrazole.
What is the SMILES notation for 2-methyl-3-propan-2-yl-5-(trifluoromethyl)-1,5-dihydropyrazole?
The canonical SMILES for 2-methyl-3-propan-2-yl-5-(trifluoromethyl)-1,5-dihydropyrazole is CC(C)C1=CC(C(F)(F)F)NN1C.
What is the InChIKey of 2-methyl-3-propan-2-yl-5-(trifluoromethyl)-1,5-dihydropyrazole?
The InChIKey is WEDNDBBHEMKVAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13F3N2/c1-5(2)6-4-7(8(9,10)11)12-13(6)3/h4-5,7,12H,1-3H3.
What are the key properties of 2-methyl-3-propan-2-yl-5-(trifluoromethyl)-1,5-dihydropyrazole?
2-methyl-3-propan-2-yl-5-(trifluoromethyl)-1,5-dihydropyrazole has a molecular weight of 194.20 g/mol, XLogP of 1.91, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3-propan-2-yl-5-(trifluoromethyl)-1,5-dihydropyrazole is sourced from PubChem (CID 162618946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).