C20H24ClF3N8O — CID 162619364
1-[(2S,5R)-5-[[2-[[1-amino-3-(2,2,2-trifluoroethylimino)prop-1-en-2-yl]amino]-5-chloro-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]-2-methylpiperidin-1-yl]prop-2-en-1-one (PubChem CID 162619364) has the molecular formula C20H24ClF3N8O and a molecular weight of 484.91 g/mol. Its IUPAC name is 1-[(2S,5R)-5-[[2-[[1-amino-3-(2,2,2-trifluoroethylimino)prop-1-en-2-yl]amino]-5-chloro-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]-2-methylpiperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(2S,5R)-5-[[2-[[1-amino-3-(2,2,2-trifluoroethylimino)prop-1-en-2-yl]amino]-5-chloro-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]-2-methylpiperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 162619364 |
| Molecular Formula | C20H24ClF3N8O |
| Molecular Weight | 484.91 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | 1-[(2S,5R)-5-[[2-[[1-amino-3-(2,2,2-trifluoroethylimino)prop-1-en-2-yl]amino]-5-chloro-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]-2-methylpiperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1C[C@H](Nc2nc(NC(=CN)/C=N/CC(F)(F)F)nc3[nH]cc(Cl)c23)CC[C@@H]1C |
| InChI | InChI=1S/C20H24ClF3N8O/c1-3-15(33)32-9-12(5-4-11(32)2)28-18-16-14(21)8-27-17(16)30-19(31-18)29-13(6-25)7-26-10-20(22,23)24/h3,6-8,11-12H,1,4-5,9-10,25H2,2H3,(H3,27,28,29,30,31)/b13-6?,26-7+/t11-,12+/m0/s1 |
| InChIKey | SONAUMZYJMMJEU-KPOCTVIOSA-N |
| XLogP | 3.43 |
| TPSA | 124.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.91 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|