C25H25Cl2F6N3O — CID 162619393
5-(3,5-dichlorophenyl)-3-[3-methyl-4-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]phenyl]-5-(2,2,2-trifluoroethyl)-4H-1,2-oxazole (PubChem CID 162619393) has the molecular formula C25H25Cl2F6N3O and a molecular weight of 568.39 g/mol. Its IUPAC name is 5-(3,5-dichlorophenyl)-3-[3-methyl-4-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]phenyl]-5-(2,2,2-trifluoroethyl)-4H-1,2-oxazole.
| Compound Name | 5-(3,5-dichlorophenyl)-3-[3-methyl-4-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]phenyl]-5-(2,2,2-trifluoroethyl)-4H-1,2-oxazole |
|---|---|
| PubChem CID | 162619393 |
| Molecular Formula | C25H25Cl2F6N3O |
| Molecular Weight | 568.39 g/mol |
| Exact Mass | 567.13 |
| IUPAC Name | 5-(3,5-dichlorophenyl)-3-[3-methyl-4-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]phenyl]-5-(2,2,2-trifluoroethyl)-4H-1,2-oxazole |
| SMILES | Cc1cc(C2=NOC(CC(F)(F)F)(c3cc(Cl)cc(Cl)c3)C2)ccc1CN1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C25H25Cl2F6N3O/c1-16-8-17(2-3-18(16)13-35-4-6-36(7-5-35)15-25(31,32)33)22-12-23(37-34-22,14-24(28,29)30)19-9-20(26)11-21(27)10-19/h2-3,8-11H,4-7,12-15H2,1H3 |
| InChIKey | AXEACTGTNQAQFL-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 28.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.39 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |