About 2-methyl-5-methylidene-3-propan-2-yl-7-(trifluoromethyl)-4,6-dihydro-3H-quinoline
2-methyl-5-methylidene-3-propan-2-yl-7-(trifluoromethyl)-4,6-dihydro-3H-quinoline (PubChem CID 162619395) has the molecular formula C15H18F3N
and a molecular weight of 269.31 g/mol. Its IUPAC name is 2-methyl-5-methylidene-3-propan-2-yl-7-(trifluoromethyl)-4,6-dihydro-3H-quinoline.
Molecular Properties
| Compound Name | 2-methyl-5-methylidene-3-propan-2-yl-7-(trifluoromethyl)-4,6-dihydro-3H-quinoline |
| PubChem CID | 162619395 |
| Molecular Formula | C15H18F3N |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 2-methyl-5-methylidene-3-propan-2-yl-7-(trifluoromethyl)-4,6-dihydro-3H-quinoline |
| SMILES | C=C1CC(C(F)(F)F)=CC2=C1CC(C(C)C)C(C)=N2 |
| InChI | InChI=1S/C15H18F3N/c1-8(2)12-7-13-9(3)5-11(15(16,17)18)6-14(13)19-10(12)4/h6,8,12H,3,5,7H2,1-2,4H3 |
| InChIKey | ILVRRDWLBFVDMM-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methyl-5-methylidene-3-propan-2-yl-7-(trifluoromethyl)-4,6-dihydro-3H-quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5-methylidene-3-propan-2-yl-7-(trifluoromethyl)-4,6-dihydro-3H-quinoline?
The IUPAC name of 2-methyl-5-methylidene-3-propan-2-yl-7-(trifluoromethyl)-4,6-dihydro-3H-quinoline (CID 162619395) is 2-methyl-5-methylidene-3-propan-2-yl-7-(trifluoromethyl)-4,6-dihydro-3H-quinoline.
What is the SMILES notation for 2-methyl-5-methylidene-3-propan-2-yl-7-(trifluoromethyl)-4,6-dihydro-3H-quinoline?
The canonical SMILES for 2-methyl-5-methylidene-3-propan-2-yl-7-(trifluoromethyl)-4,6-dihydro-3H-quinoline is C=C1CC(C(F)(F)F)=CC2=C1CC(C(C)C)C(C)=N2.
What is the InChIKey of 2-methyl-5-methylidene-3-propan-2-yl-7-(trifluoromethyl)-4,6-dihydro-3H-quinoline?
The InChIKey is ILVRRDWLBFVDMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18F3N/c1-8(2)12-7-13-9(3)5-11(15(16,17)18)6-14(13)19-10(12)4/h6,8,12H,3,5,7H2,1-2,4H3.
What are the key properties of 2-methyl-5-methylidene-3-propan-2-yl-7-(trifluoromethyl)-4,6-dihydro-3H-quinoline?
2-methyl-5-methylidene-3-propan-2-yl-7-(trifluoromethyl)-4,6-dihydro-3H-quinoline has a molecular weight of 269.31 g/mol, XLogP of 4.83, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5-methylidene-3-propan-2-yl-7-(trifluoromethyl)-4,6-dihydro-3H-quinoline is sourced from PubChem (CID 162619395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).