About 1-[(2R)-1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-enyl]pyrrolidine
1-[(2R)-1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-enyl]pyrrolidine (PubChem CID 162620213) has the molecular formula C10H14F5N
and a molecular weight of 243.22 g/mol. Its IUPAC name is 1-[(2R)-1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-enyl]pyrrolidine.
Molecular Properties
| Compound Name | 1-[(2R)-1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-enyl]pyrrolidine |
| PubChem CID | 162620213 |
| Molecular Formula | C10H14F5N |
| Molecular Weight | 243.22 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 1-[(2R)-1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-enyl]pyrrolidine |
| SMILES | C=C(C)[C@@](F)(C(F)N1CCCC1)C(F)(F)F |
| InChI | InChI=1S/C10H14F5N/c1-7(2)9(12,10(13,14)15)8(11)16-5-3-4-6-16/h8H,1,3-6H2,2H3/t8?,9-/m1/s1 |
| InChIKey | BIZDAGBHJYTFMU-YGPZHTELSA-N |
| XLogP | 3.22 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.22 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2R)-1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-enyl]pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2R)-1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-enyl]pyrrolidine?
The IUPAC name of 1-[(2R)-1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-enyl]pyrrolidine (CID 162620213) is 1-[(2R)-1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-enyl]pyrrolidine.
What is the SMILES notation for 1-[(2R)-1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-enyl]pyrrolidine?
The canonical SMILES for 1-[(2R)-1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-enyl]pyrrolidine is C=C(C)[C@@](F)(C(F)N1CCCC1)C(F)(F)F.
What is the InChIKey of 1-[(2R)-1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-enyl]pyrrolidine?
The InChIKey is BIZDAGBHJYTFMU-YGPZHTELSA-N. The full InChI is InChI=1S/C10H14F5N/c1-7(2)9(12,10(13,14)15)8(11)16-5-3-4-6-16/h8H,1,3-6H2,2H3/t8?,9-/m1/s1.
What are the key properties of 1-[(2R)-1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-enyl]pyrrolidine?
1-[(2R)-1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-enyl]pyrrolidine has a molecular weight of 243.22 g/mol, XLogP of 3.22, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2R)-1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-enyl]pyrrolidine is sourced from PubChem (CID 162620213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).