C17H22F3NO — CID 162620483
(2E)-N-[(1Z,3E,5E)-5-methoxy-4,6-dimethylocta-1,3,5-trienyl]-2-(trifluoromethyl)penta-2,4-dien-1-imine (PubChem CID 162620483) has the molecular formula C17H22F3NO and a molecular weight of 313.36 g/mol. Its IUPAC name is (2E)-N-[(1Z,3E,5E)-5-methoxy-4,6-dimethylocta-1,3,5-trienyl]-2-(trifluoromethyl)penta-2,4-dien-1-imine.
| Compound Name | (2E)-N-[(1Z,3E,5E)-5-methoxy-4,6-dimethylocta-1,3,5-trienyl]-2-(trifluoromethyl)penta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 162620483 |
| Molecular Formula | C17H22F3NO |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | (2E)-N-[(1Z,3E,5E)-5-methoxy-4,6-dimethylocta-1,3,5-trienyl]-2-(trifluoromethyl)penta-2,4-dien-1-imine |
| SMILES | C=C/C=C(\C=N\C=C/C=C(C)/C(OC)=C(/C)CC)C(F)(F)F |
| InChI | InChI=1S/C17H22F3NO/c1-6-9-15(17(18,19)20)12-21-11-8-10-14(4)16(22-5)13(3)7-2/h6,8-12H,1,7H2,2-5H3/b11-8-,14-10+,15-9+,16-13+,21-12+ |
| InChIKey | BNTJQJZJUITVGT-AJHYCCGASA-N |
| XLogP | 5.52 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|