C20H29F3N2O3 — CID 162620608
N-ethyl-N'-[2-ethyl-5-methoxy-4-[2,2,2-trifluoro-1-hydroxy-1-(oxan-4-yl)ethyl]phenyl]-N-methylmethanimidamide (PubChem CID 162620608) has the molecular formula C20H29F3N2O3 and a molecular weight of 402.46 g/mol. Its IUPAC name is N-ethyl-N'-[2-ethyl-5-methoxy-4-[2,2,2-trifluoro-1-hydroxy-1-(oxan-4-yl)ethyl]phenyl]-N-methylmethanimidamide.
| Compound Name | N-ethyl-N'-[2-ethyl-5-methoxy-4-[2,2,2-trifluoro-1-hydroxy-1-(oxan-4-yl)ethyl]phenyl]-N-methylmethanimidamide |
|---|---|
| PubChem CID | 162620608 |
| Molecular Formula | C20H29F3N2O3 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | N-ethyl-N'-[2-ethyl-5-methoxy-4-[2,2,2-trifluoro-1-hydroxy-1-(oxan-4-yl)ethyl]phenyl]-N-methylmethanimidamide |
| SMILES | CCc1cc(C(O)(C2CCOCC2)C(F)(F)F)c(OC)cc1/N=C/N(C)CC |
| InChI | InChI=1S/C20H29F3N2O3/c1-5-14-11-16(18(27-4)12-17(14)24-13-25(3)6-2)19(26,20(21,22)23)15-7-9-28-10-8-15/h11-13,15,26H,5-10H2,1-4H3/b24-13+ |
| InChIKey | QUIFLZHEFOISJO-ZMOGYAJESA-N |
| XLogP | 4.05 |
| TPSA | 54.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|