C37H36F3N3O4S — CID 162620686
1-[(3,4-dimethoxyphenyl)methyl]-5-[2-[(Z)-ethylidene-(3-phenyl-3-phenylmethoxypropyl)-λ4-sulfanyl]-6-(trifluoromethyl)pyrimidin-4-yl]pyridin-2-one (PubChem CID 162620686) has the molecular formula C37H36F3N3O4S and a molecular weight of 675.77 g/mol. Its IUPAC name is 1-[(3,4-dimethoxyphenyl)methyl]-5-[2-[(Z)-ethylidene-(3-phenyl-3-phenylmethoxypropyl)-λ4-sulfanyl]-6-(trifluoromethyl)pyrimidin-4-yl]pyridin-2-one.
| Compound Name | 1-[(3,4-dimethoxyphenyl)methyl]-5-[2-[(Z)-ethylidene-(3-phenyl-3-phenylmethoxypropyl)-λ4-sulfanyl]-6-(trifluoromethyl)pyrimidin-4-yl]pyridin-2-one |
|---|---|
| PubChem CID | 162620686 |
| Molecular Formula | C37H36F3N3O4S |
| Molecular Weight | 675.77 g/mol |
| Exact Mass | 675.24 |
| IUPAC Name | 1-[(3,4-dimethoxyphenyl)methyl]-5-[2-[(Z)-ethylidene-(3-phenyl-3-phenylmethoxypropyl)-λ4-sulfanyl]-6-(trifluoromethyl)pyrimidin-4-yl]pyridin-2-one |
| SMILES | C/C=S(/CCC(OCc1ccccc1)c1ccccc1)c1nc(-c2ccc(=O)n(Cc3ccc(OC)c(OC)c3)c2)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C37H36F3N3O4S/c1-4-48(20-19-31(28-13-9-6-10-14-28)47-25-26-11-7-5-8-12-26)36-41-30(22-34(42-36)37(38,39)40)29-16-18-35(44)43(24-29)23-27-15-17-32(45-2)33(21-27)46-3/h4-18,21-22,24,31H,19-20,23,25H2,1-3H3 |
| InChIKey | WBTSEEJCJWXHCE-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 75.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.77 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|