C15H22F3NO4 — CID 162620780
(2R,3R,4R,5S)-2-(hydroxymethyl)-1-[[1-methyl-4-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]methyl]piperidine-3,4,5-triol (PubChem CID 162620780) has the molecular formula C15H22F3NO4 and a molecular weight of 337.34 g/mol. Its IUPAC name is (2R,3R,4R,5S)-2-(hydroxymethyl)-1-[[1-methyl-4-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]methyl]piperidine-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S)-2-(hydroxymethyl)-1-[[1-methyl-4-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]methyl]piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 162620780 |
| Molecular Formula | C15H22F3NO4 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | (2R,3R,4R,5S)-2-(hydroxymethyl)-1-[[1-methyl-4-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]methyl]piperidine-3,4,5-triol |
| SMILES | CC1(CN2C[C@H](O)[C@@H](O)[C@H](O)[C@H]2CO)C=CC(C(F)(F)F)=CC1 |
| InChI | InChI=1S/C15H22F3NO4/c1-14(4-2-9(3-5-14)15(16,17)18)8-19-6-11(21)13(23)12(22)10(19)7-20/h2-4,10-13,20-23H,5-8H2,1H3/t10-,11+,12-,13-,14?/m1/s1 |
| InChIKey | NATGMDRNPBRKPW-DYPLGBCKSA-N |
| XLogP | 0.20 |
| TPSA | 84.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |