C14H21F3N2O3 — CID 162620938
N-[2-[(2-cyclooct-2-en-1-yloxyacetyl)amino]ethyl]-2,2,2-trifluoroacetamide (PubChem CID 162620938) has the molecular formula C14H21F3N2O3 and a molecular weight of 322.33 g/mol. Its IUPAC name is N-[2-[(2-cyclooct-2-en-1-yloxyacetyl)amino]ethyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[2-[(2-cyclooct-2-en-1-yloxyacetyl)amino]ethyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 162620938 |
| Molecular Formula | C14H21F3N2O3 |
| Molecular Weight | 322.33 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | N-[2-[(2-cyclooct-2-en-1-yloxyacetyl)amino]ethyl]-2,2,2-trifluoroacetamide |
| SMILES | O=C(COC1C=CCCCCC1)NCCNC(=O)C(F)(F)F |
| InChI | InChI=1S/C14H21F3N2O3/c15-14(16,17)13(21)19-9-8-18-12(20)10-22-11-6-4-2-1-3-5-7-11/h4,6,11H,1-3,5,7-10H2,(H,18,20)(H,19,21) |
| InChIKey | KFDYQRQZPMXZRL-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.33 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|