C10H11F10N2O4S3+ — CID 162621321
1-ethyl-3-methylimidazol-3-ium;1,1,1,2,2-pentafluoro-2-(1,1,2,2,2-pentafluoroethylsulfonylsulfanylsulfonyl)ethane (PubChem CID 162621321) has the molecular formula C10H11F10N2O4S3+ and a molecular weight of 509.39 g/mol. Its IUPAC name is 1-ethyl-3-methylimidazol-3-ium;1,1,1,2,2-pentafluoro-2-(1,1,2,2,2-pentafluoroethylsulfonylsulfanylsulfonyl)ethane.
| Compound Name | 1-ethyl-3-methylimidazol-3-ium;1,1,1,2,2-pentafluoro-2-(1,1,2,2,2-pentafluoroethylsulfonylsulfanylsulfonyl)ethane |
|---|---|
| PubChem CID | 162621321 |
| Molecular Formula | C10H11F10N2O4S3+ |
| Molecular Weight | 509.39 g/mol |
| Exact Mass | 508.97 |
| IUPAC Name | 1-ethyl-3-methylimidazol-3-ium;1,1,1,2,2-pentafluoro-2-(1,1,2,2,2-pentafluoroethylsulfonylsulfanylsulfonyl)ethane |
| SMILES | CCn1cc[n+](C)c1.O=S(=O)(SS(=O)(=O)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H11N2.C4F10O4S3/c1-3-8-5-4-7(2)6-8;5-1(6,7)3(11,12)20(15,16)19-21(17,18)4(13,14)2(8,9)10/h4-6H,3H2,1-2H3;/q+1; |
| InChIKey | RFDUWGQLAUJTND-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 77.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.39 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|