C30H25Cl2F3N2O2 — CID 162621342
2-[(3,4-dichlorophenyl)methyl]-3,4-dihydro-1H-isoquinolin-6-amine;2-[4-(trifluoromethyl)phenyl]benzoic acid (PubChem CID 162621342) has the molecular formula C30H25Cl2F3N2O2 and a molecular weight of 573.44 g/mol. Its IUPAC name is 2-[(3,4-dichlorophenyl)methyl]-3,4-dihydro-1H-isoquinolin-6-amine;2-[4-(trifluoromethyl)phenyl]benzoic acid.
| Compound Name | 2-[(3,4-dichlorophenyl)methyl]-3,4-dihydro-1H-isoquinolin-6-amine;2-[4-(trifluoromethyl)phenyl]benzoic acid |
|---|---|
| PubChem CID | 162621342 |
| Molecular Formula | C30H25Cl2F3N2O2 |
| Molecular Weight | 573.44 g/mol |
| Exact Mass | 572.12 |
| IUPAC Name | 2-[(3,4-dichlorophenyl)methyl]-3,4-dihydro-1H-isoquinolin-6-amine;2-[4-(trifluoromethyl)phenyl]benzoic acid |
| SMILES | Nc1ccc2c(c1)CCN(Cc1ccc(Cl)c(Cl)c1)C2.O=C(O)c1ccccc1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H16Cl2N2.C14H9F3O2/c17-15-4-1-11(7-16(15)18)9-20-6-5-12-8-14(19)3-2-13(12)10-20;15-14(16,17)10-7-5-9(6-8-10)11-3-1-2-4-12(11)13(18)19/h1-4,7-8H,5-6,9-10,19H2;1-8H,(H,18,19) |
| InChIKey | JOMKVGWXZDLIMQ-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.44 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|