C32H40F4O4S2 — CID 162621482
2-(2-bicyclo[2.2.1]heptanyl)-1,1,2,2-tetrafluoroethanesulfonic acid;1-(4-butoxynaphthalen-1-yl)-4-thiatricyclo[5.2.1.02,6]decane (PubChem CID 162621482) has the molecular formula C32H40F4O4S2 and a molecular weight of 628.79 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]heptanyl)-1,1,2,2-tetrafluoroethanesulfonic acid;1-(4-butoxynaphthalen-1-yl)-4-thiatricyclo[5.2.1.02,6]decane.
| Compound Name | 2-(2-bicyclo[2.2.1]heptanyl)-1,1,2,2-tetrafluoroethanesulfonic acid;1-(4-butoxynaphthalen-1-yl)-4-thiatricyclo[5.2.1.02,6]decane |
|---|---|
| PubChem CID | 162621482 |
| Molecular Formula | C32H40F4O4S2 |
| Molecular Weight | 628.79 g/mol |
| Exact Mass | 628.23 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]heptanyl)-1,1,2,2-tetrafluoroethanesulfonic acid;1-(4-butoxynaphthalen-1-yl)-4-thiatricyclo[5.2.1.02,6]decane |
| SMILES | CCCCOc1ccc(C23CCC(C2)C2CSCC23)c2ccccc12.O=S(=O)(O)C(F)(F)C(F)(F)C1CC2CCC1C2 |
| InChI | InChI=1S/C23H28OS.C9H12F4O3S/c1-2-3-12-24-22-9-8-20(17-6-4-5-7-18(17)22)23-11-10-16(13-23)19-14-25-15-21(19)23;10-8(11,9(12,13)17(14,15)16)7-4-5-1-2-6(7)3-5/h4-9,16,19,21H,2-3,10-15H2,1H3;5-7H,1-4H2,(H,14,15,16) |
| InChIKey | TVJBNBQZMTZJHF-UHFFFAOYSA-N |
| XLogP | 8.59 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.79 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|