C14H14F6N4O2 — CID 162621656
3-(difluoromethyl)-1-methylpyrazole-4-carboxamide;2-(1,1,2,2-tetrafluoroethoxy)aniline (PubChem CID 162621656) has the molecular formula C14H14F6N4O2 and a molecular weight of 384.28 g/mol. Its IUPAC name is 3-(difluoromethyl)-1-methylpyrazole-4-carboxamide;2-(1,1,2,2-tetrafluoroethoxy)aniline.
| Compound Name | 3-(difluoromethyl)-1-methylpyrazole-4-carboxamide;2-(1,1,2,2-tetrafluoroethoxy)aniline |
|---|---|
| PubChem CID | 162621656 |
| Molecular Formula | C14H14F6N4O2 |
| Molecular Weight | 384.28 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | 3-(difluoromethyl)-1-methylpyrazole-4-carboxamide;2-(1,1,2,2-tetrafluoroethoxy)aniline |
| SMILES | Cn1cc(C(N)=O)c(C(F)F)n1.Nc1ccccc1OC(F)(F)C(F)F |
| InChI | InChI=1S/C8H7F4NO.C6H7F2N3O/c9-7(10)8(11,12)14-6-4-2-1-3-5(6)13;1-11-2-3(6(9)12)4(10-11)5(7)8/h1-4,7H,13H2;2,5H,1H3,(H2,9,12) |
| InChIKey | NVYMKPQLBABWRR-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 96.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.28 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|