C20H15F3N4O4 — CID 162621750
1-(4-aminophenyl)ethanone;5-(furan-2-yl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxylic acid (PubChem CID 162621750) has the molecular formula C20H15F3N4O4 and a molecular weight of 432.36 g/mol. Its IUPAC name is 1-(4-aminophenyl)ethanone;5-(furan-2-yl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxylic acid.
| Compound Name | 1-(4-aminophenyl)ethanone;5-(furan-2-yl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxylic acid |
|---|---|
| PubChem CID | 162621750 |
| Molecular Formula | C20H15F3N4O4 |
| Molecular Weight | 432.36 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | 1-(4-aminophenyl)ethanone;5-(furan-2-yl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxylic acid |
| SMILES | CC(=O)c1ccc(N)cc1.O=C(O)c1cc2nc(-c3ccco3)cc(C(F)(F)F)n2n1 |
| InChI | InChI=1S/C12H6F3N3O3.C8H9NO/c13-12(14,15)9-4-6(8-2-1-3-21-8)16-10-5-7(11(19)20)17-18(9)10;1-6(10)7-2-4-8(9)5-3-7/h1-5H,(H,19,20);2-5H,9H2,1H3 |
| InChIKey | OHRTUDTVEFHBND-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 123.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.36 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|