C7F18S — CID 162621792
tris(1,1,2,2,2-pentafluoroethyl)-(trifluoromethyl)-λ4-sulfane (PubChem CID 162621792) has the molecular formula C7F18S and a molecular weight of 458.11 g/mol. Its IUPAC name is tris(1,1,2,2,2-pentafluoroethyl)-(trifluoromethyl)-λ4-sulfane.
| Compound Name | tris(1,1,2,2,2-pentafluoroethyl)-(trifluoromethyl)-λ4-sulfane |
|---|---|
| PubChem CID | 162621792 |
| Molecular Formula | C7F18S |
| Molecular Weight | 458.11 g/mol |
| Exact Mass | 457.94 |
| IUPAC Name | tris(1,1,2,2,2-pentafluoroethyl)-(trifluoromethyl)-λ4-sulfane |
| SMILES | FC(F)(F)C(F)(F)S(C(F)(F)F)(C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7F18S/c8-1(9,10)4(17,18)26(7(23,24)25,5(19,20)2(11,12)13)6(21,22)3(14,15)16 |
| InChIKey | IEDFOHOKUYRPKM-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.11 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|