About phenyl 2,2,2-trifluoroacetate;1-propan-2-yl-4-(4-propan-2-ylphenyl)sulfanylbenzene
phenyl 2,2,2-trifluoroacetate;1-propan-2-yl-4-(4-propan-2-ylphenyl)sulfanylbenzene (PubChem CID 162621892) has the molecular formula C26H27F3O2S
and a molecular weight of 460.56 g/mol. Its IUPAC name is phenyl 2,2,2-trifluoroacetate;1-propan-2-yl-4-(4-propan-2-ylphenyl)sulfanylbenzene.
Molecular Properties
| Compound Name | phenyl 2,2,2-trifluoroacetate;1-propan-2-yl-4-(4-propan-2-ylphenyl)sulfanylbenzene |
| PubChem CID | 162621892 |
| Molecular Formula | C26H27F3O2S |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | phenyl 2,2,2-trifluoroacetate;1-propan-2-yl-4-(4-propan-2-ylphenyl)sulfanylbenzene |
| SMILES | CC(C)c1ccc(Sc2ccc(C(C)C)cc2)cc1.O=C(Oc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C18H22S.C8H5F3O2/c1-13(2)15-5-9-17(10-6-15)19-18-11-7-16(8-12-18)14(3)4;9-8(10,11)7(12)13-6-4-2-1-3-5-6/h5-14H,1-4H3;1-5H |
| InChIKey | OWQAICZHPSJROO-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze phenyl 2,2,2-trifluoroacetate;1-propan-2-yl-4-(4-propan-2-ylphenyl)sulfanylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl 2,2,2-trifluoroacetate;1-propan-2-yl-4-(4-propan-2-ylphenyl)sulfanylbenzene?
The IUPAC name of phenyl 2,2,2-trifluoroacetate;1-propan-2-yl-4-(4-propan-2-ylphenyl)sulfanylbenzene (CID 162621892) is phenyl 2,2,2-trifluoroacetate;1-propan-2-yl-4-(4-propan-2-ylphenyl)sulfanylbenzene.
What is the SMILES notation for phenyl 2,2,2-trifluoroacetate;1-propan-2-yl-4-(4-propan-2-ylphenyl)sulfanylbenzene?
The canonical SMILES for phenyl 2,2,2-trifluoroacetate;1-propan-2-yl-4-(4-propan-2-ylphenyl)sulfanylbenzene is CC(C)c1ccc(Sc2ccc(C(C)C)cc2)cc1.O=C(Oc1ccccc1)C(F)(F)F.
What is the InChIKey of phenyl 2,2,2-trifluoroacetate;1-propan-2-yl-4-(4-propan-2-ylphenyl)sulfanylbenzene?
The InChIKey is OWQAICZHPSJROO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22S.C8H5F3O2/c1-13(2)15-5-9-17(10-6-15)19-18-11-7-16(8-12-18)14(3)4;9-8(10,11)7(12)13-6-4-2-1-3-5-6/h5-14H,1-4H3;1-5H.
What are the key properties of phenyl 2,2,2-trifluoroacetate;1-propan-2-yl-4-(4-propan-2-ylphenyl)sulfanylbenzene?
phenyl 2,2,2-trifluoroacetate;1-propan-2-yl-4-(4-propan-2-ylphenyl)sulfanylbenzene has a molecular weight of 460.56 g/mol, XLogP of 8.24, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl 2,2,2-trifluoroacetate;1-propan-2-yl-4-(4-propan-2-ylphenyl)sulfanylbenzene is sourced from PubChem (CID 162621892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).