About bis[4-(trifluoromethyl)phenyl]phosphane;fluoromethanesulfonic acid
bis[4-(trifluoromethyl)phenyl]phosphane;fluoromethanesulfonic acid (PubChem CID 162621899) has the molecular formula C15H12F7O3PS
and a molecular weight of 436.29 g/mol. Its IUPAC name is bis[4-(trifluoromethyl)phenyl]phosphane;fluoromethanesulfonic acid.
Molecular Properties
| Compound Name | bis[4-(trifluoromethyl)phenyl]phosphane;fluoromethanesulfonic acid |
| PubChem CID | 162621899 |
| Molecular Formula | C15H12F7O3PS |
| Molecular Weight | 436.29 g/mol |
| Exact Mass | 436.01 |
| IUPAC Name | bis[4-(trifluoromethyl)phenyl]phosphane;fluoromethanesulfonic acid |
| SMILES | FC(F)(F)c1ccc(Pc2ccc(C(F)(F)F)cc2)cc1.O=S(=O)(O)CF |
| InChI | InChI=1S/C14H9F6P.CH3FO3S/c15-13(16,17)9-1-5-11(6-2-9)21-12-7-3-10(4-8-12)14(18,19)20;2-1-6(3,4)5/h1-8,21H;1H2,(H,3,4,5) |
| InChIKey | UBBDQCYMQYQLEZ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 436.29 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze bis[4-(trifluoromethyl)phenyl]phosphane;fluoromethanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[4-(trifluoromethyl)phenyl]phosphane;fluoromethanesulfonic acid?
The IUPAC name of bis[4-(trifluoromethyl)phenyl]phosphane;fluoromethanesulfonic acid (CID 162621899) is bis[4-(trifluoromethyl)phenyl]phosphane;fluoromethanesulfonic acid.
What is the SMILES notation for bis[4-(trifluoromethyl)phenyl]phosphane;fluoromethanesulfonic acid?
The canonical SMILES for bis[4-(trifluoromethyl)phenyl]phosphane;fluoromethanesulfonic acid is FC(F)(F)c1ccc(Pc2ccc(C(F)(F)F)cc2)cc1.O=S(=O)(O)CF.
What is the InChIKey of bis[4-(trifluoromethyl)phenyl]phosphane;fluoromethanesulfonic acid?
The InChIKey is UBBDQCYMQYQLEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9F6P.CH3FO3S/c15-13(16,17)9-1-5-11(6-2-9)21-12-7-3-10(4-8-12)14(18,19)20;2-1-6(3,4)5/h1-8,21H;1H2,(H,3,4,5).
What are the key properties of bis[4-(trifluoromethyl)phenyl]phosphane;fluoromethanesulfonic acid?
bis[4-(trifluoromethyl)phenyl]phosphane;fluoromethanesulfonic acid has a molecular weight of 436.29 g/mol, XLogP of 4.15, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis[4-(trifluoromethyl)phenyl]phosphane;fluoromethanesulfonic acid is sourced from PubChem (CID 162621899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).