About 1-thiophen-2-ylethanamine;5-[3-(trifluoromethyl)phenyl]-1,2,4-thiadiazole-3-carboxylic acid
1-thiophen-2-ylethanamine;5-[3-(trifluoromethyl)phenyl]-1,2,4-thiadiazole-3-carboxylic acid (PubChem CID 162622063) has the molecular formula C16H14F3N3O2S2
and a molecular weight of 401.44 g/mol. Its IUPAC name is 1-thiophen-2-ylethanamine;5-[3-(trifluoromethyl)phenyl]-1,2,4-thiadiazole-3-carboxylic acid.
Molecular Properties
| Compound Name | 1-thiophen-2-ylethanamine;5-[3-(trifluoromethyl)phenyl]-1,2,4-thiadiazole-3-carboxylic acid |
| PubChem CID | 162622063 |
| Molecular Formula | C16H14F3N3O2S2 |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.05 |
| IUPAC Name | 1-thiophen-2-ylethanamine;5-[3-(trifluoromethyl)phenyl]-1,2,4-thiadiazole-3-carboxylic acid |
| SMILES | CC(N)c1cccs1.O=C(O)c1nsc(-c2cccc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C10H5F3N2O2S.C6H9NS/c11-10(12,13)6-3-1-2-5(4-6)8-14-7(9(16)17)15-18-8;1-5(7)6-3-2-4-8-6/h1-4H,(H,16,17);2-5H,7H2,1H3 |
| InChIKey | XESYUFCLNKQJKM-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-thiophen-2-ylethanamine;5-[3-(trifluoromethyl)phenyl]-1,2,4-thiadiazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-thiophen-2-ylethanamine;5-[3-(trifluoromethyl)phenyl]-1,2,4-thiadiazole-3-carboxylic acid?
The IUPAC name of 1-thiophen-2-ylethanamine;5-[3-(trifluoromethyl)phenyl]-1,2,4-thiadiazole-3-carboxylic acid (CID 162622063) is 1-thiophen-2-ylethanamine;5-[3-(trifluoromethyl)phenyl]-1,2,4-thiadiazole-3-carboxylic acid.
What is the SMILES notation for 1-thiophen-2-ylethanamine;5-[3-(trifluoromethyl)phenyl]-1,2,4-thiadiazole-3-carboxylic acid?
The canonical SMILES for 1-thiophen-2-ylethanamine;5-[3-(trifluoromethyl)phenyl]-1,2,4-thiadiazole-3-carboxylic acid is CC(N)c1cccs1.O=C(O)c1nsc(-c2cccc(C(F)(F)F)c2)n1.
What is the InChIKey of 1-thiophen-2-ylethanamine;5-[3-(trifluoromethyl)phenyl]-1,2,4-thiadiazole-3-carboxylic acid?
The InChIKey is XESYUFCLNKQJKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5F3N2O2S.C6H9NS/c11-10(12,13)6-3-1-2-5(4-6)8-14-7(9(16)17)15-18-8;1-5(7)6-3-2-4-8-6/h1-4H,(H,16,17);2-5H,7H2,1H3.
What are the key properties of 1-thiophen-2-ylethanamine;5-[3-(trifluoromethyl)phenyl]-1,2,4-thiadiazole-3-carboxylic acid?
1-thiophen-2-ylethanamine;5-[3-(trifluoromethyl)phenyl]-1,2,4-thiadiazole-3-carboxylic acid has a molecular weight of 401.44 g/mol, XLogP of 4.69, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-thiophen-2-ylethanamine;5-[3-(trifluoromethyl)phenyl]-1,2,4-thiadiazole-3-carboxylic acid is sourced from PubChem (CID 162622063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).