About 12-bromo-10-(trifluoromethoxy)-21,22-dihydroporphyrin
12-bromo-10-(trifluoromethoxy)-21,22-dihydroporphyrin (PubChem CID 162622094) has the molecular formula C21H12BrF3N4O
and a molecular weight of 473.25 g/mol. Its IUPAC name is 12-bromo-10-(trifluoromethoxy)-21,22-dihydroporphyrin.
Molecular Properties
| Compound Name | 12-bromo-10-(trifluoromethoxy)-21,22-dihydroporphyrin |
| PubChem CID | 162622094 |
| Molecular Formula | C21H12BrF3N4O |
| Molecular Weight | 473.25 g/mol |
| Exact Mass | 472.01 |
| IUPAC Name | 12-bromo-10-(trifluoromethoxy)-21,22-dihydroporphyrin |
| SMILES | FC(F)(F)Oc1c2nc(cc3nc(cc4ccc(cc5ccc1[nH]5)[nH]4)C=C3)C=C2Br |
| InChI | InChI=1S/C21H12BrF3N4O/c22-17-10-16-9-14-4-3-12(27-14)7-11-1-2-13(26-11)8-15-5-6-18(28-15)20(19(17)29-16)30-21(23,24)25/h1-10,26,28H/b11-7-,12-7-,13-8-,14-9-,15-8-,16-9-,20-18+,20-19+ |
| InChIKey | MYDAMKWZYVPRIB-JFPRGAJNSA-N |
| XLogP | 6.28 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 473.25 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 12-bromo-10-(trifluoromethoxy)-21,22-dihydroporphyrin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 12-bromo-10-(trifluoromethoxy)-21,22-dihydroporphyrin?
The IUPAC name of 12-bromo-10-(trifluoromethoxy)-21,22-dihydroporphyrin (CID 162622094) is 12-bromo-10-(trifluoromethoxy)-21,22-dihydroporphyrin.
What is the SMILES notation for 12-bromo-10-(trifluoromethoxy)-21,22-dihydroporphyrin?
The canonical SMILES for 12-bromo-10-(trifluoromethoxy)-21,22-dihydroporphyrin is FC(F)(F)Oc1c2nc(cc3nc(cc4ccc(cc5ccc1[nH]5)[nH]4)C=C3)C=C2Br.
What is the InChIKey of 12-bromo-10-(trifluoromethoxy)-21,22-dihydroporphyrin?
The InChIKey is MYDAMKWZYVPRIB-JFPRGAJNSA-N. The full InChI is InChI=1S/C21H12BrF3N4O/c22-17-10-16-9-14-4-3-12(27-14)7-11-1-2-13(26-11)8-15-5-6-18(28-15)20(19(17)29-16)30-21(23,24)25/h1-10,26,28H/b11-7-,12-7-,13-8-,14-9-,15-8-,16-9-,20-18+,20-19+.
What are the key properties of 12-bromo-10-(trifluoromethoxy)-21,22-dihydroporphyrin?
12-bromo-10-(trifluoromethoxy)-21,22-dihydroporphyrin has a molecular weight of 473.25 g/mol, XLogP of 6.28, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 12-bromo-10-(trifluoromethoxy)-21,22-dihydroporphyrin is sourced from PubChem (CID 162622094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).