C24H21F3N4O5S — CID 162622590
[2-amino-5-(3-fluorophenyl)-1,3-thiazol-4-yl]-[(1S,3S,5S)-3-(aminomethyl)-2-azabicyclo[3.1.0]hexan-2-yl]methanone;2,2-difluoro-1,3-benzodioxole-4-carboxylic acid (PubChem CID 162622590) has the molecular formula C24H21F3N4O5S and a molecular weight of 534.52 g/mol. Its IUPAC name is [2-amino-5-(3-fluorophenyl)-1,3-thiazol-4-yl]-[(1S,3S,5S)-3-(aminomethyl)-2-azabicyclo[3.1.0]hexan-2-yl]methanone;2,2-difluoro-1,3-benzodioxole-4-carboxylic acid.
| Compound Name | [2-amino-5-(3-fluorophenyl)-1,3-thiazol-4-yl]-[(1S,3S,5S)-3-(aminomethyl)-2-azabicyclo[3.1.0]hexan-2-yl]methanone;2,2-difluoro-1,3-benzodioxole-4-carboxylic acid |
|---|---|
| PubChem CID | 162622590 |
| Molecular Formula | C24H21F3N4O5S |
| Molecular Weight | 534.52 g/mol |
| Exact Mass | 534.12 |
| IUPAC Name | [2-amino-5-(3-fluorophenyl)-1,3-thiazol-4-yl]-[(1S,3S,5S)-3-(aminomethyl)-2-azabicyclo[3.1.0]hexan-2-yl]methanone;2,2-difluoro-1,3-benzodioxole-4-carboxylic acid |
| SMILES | NC[C@@H]1C[C@@H]2C[C@@H]2N1C(=O)c1nc(N)sc1-c1cccc(F)c1.O=C(O)c1cccc2c1OC(F)(F)O2 |
| InChI | InChI=1S/C16H17FN4OS.C8H4F2O4/c17-10-3-1-2-8(4-10)14-13(20-16(19)23-14)15(22)21-11(7-18)5-9-6-12(9)21;9-8(10)13-5-3-1-2-4(7(11)12)6(5)14-8/h1-4,9,11-12H,5-7,18H2,(H2,19,20);1-3H,(H,11,12)/t9-,11+,12+;/m1./s1 |
| InChIKey | JECNMUNOLVPOMN-MNRZFKEHSA-N |
| XLogP | 3.80 |
| TPSA | 141.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.52 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |