About quinoxaline-2-carboxylic acid;N-[[3-(trifluoromethyl)phenyl]methyl]butan-1-amine
quinoxaline-2-carboxylic acid;N-[[3-(trifluoromethyl)phenyl]methyl]butan-1-amine (PubChem CID 162622828) has the molecular formula C21H22F3N3O2
and a molecular weight of 405.42 g/mol. Its IUPAC name is quinoxaline-2-carboxylic acid;N-[[3-(trifluoromethyl)phenyl]methyl]butan-1-amine.
Molecular Properties
| Compound Name | quinoxaline-2-carboxylic acid;N-[[3-(trifluoromethyl)phenyl]methyl]butan-1-amine |
| PubChem CID | 162622828 |
| Molecular Formula | C21H22F3N3O2 |
| Molecular Weight | 405.42 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | quinoxaline-2-carboxylic acid;N-[[3-(trifluoromethyl)phenyl]methyl]butan-1-amine |
| SMILES | CCCCNCc1cccc(C(F)(F)F)c1.O=C(O)c1cnc2ccccc2n1 |
| InChI | InChI=1S/C12H16F3N.C9H6N2O2/c1-2-3-7-16-9-10-5-4-6-11(8-10)12(13,14)15;12-9(13)8-5-10-6-3-1-2-4-7(6)11-8/h4-6,8,16H,2-3,7,9H2,1H3;1-5H,(H,12,13) |
| InChIKey | HNXMVAUXCJMEKB-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.42 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze quinoxaline-2-carboxylic acid;N-[[3-(trifluoromethyl)phenyl]methyl]butan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinoxaline-2-carboxylic acid;N-[[3-(trifluoromethyl)phenyl]methyl]butan-1-amine?
The IUPAC name of quinoxaline-2-carboxylic acid;N-[[3-(trifluoromethyl)phenyl]methyl]butan-1-amine (CID 162622828) is quinoxaline-2-carboxylic acid;N-[[3-(trifluoromethyl)phenyl]methyl]butan-1-amine.
What is the SMILES notation for quinoxaline-2-carboxylic acid;N-[[3-(trifluoromethyl)phenyl]methyl]butan-1-amine?
The canonical SMILES for quinoxaline-2-carboxylic acid;N-[[3-(trifluoromethyl)phenyl]methyl]butan-1-amine is CCCCNCc1cccc(C(F)(F)F)c1.O=C(O)c1cnc2ccccc2n1.
What is the InChIKey of quinoxaline-2-carboxylic acid;N-[[3-(trifluoromethyl)phenyl]methyl]butan-1-amine?
The InChIKey is HNXMVAUXCJMEKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16F3N.C9H6N2O2/c1-2-3-7-16-9-10-5-4-6-11(8-10)12(13,14)15;12-9(13)8-5-10-6-3-1-2-4-7(6)11-8/h4-6,8,16H,2-3,7,9H2,1H3;1-5H,(H,12,13).
What are the key properties of quinoxaline-2-carboxylic acid;N-[[3-(trifluoromethyl)phenyl]methyl]butan-1-amine?
quinoxaline-2-carboxylic acid;N-[[3-(trifluoromethyl)phenyl]methyl]butan-1-amine has a molecular weight of 405.42 g/mol, XLogP of 4.92, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for quinoxaline-2-carboxylic acid;N-[[3-(trifluoromethyl)phenyl]methyl]butan-1-amine is sourced from PubChem (CID 162622828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).