About fluoroform;1-(2-phenylphenyl)naphthalene;sulfane
fluoroform;1-(2-phenylphenyl)naphthalene;sulfane (PubChem CID 162622934) has the molecular formula C23H19F3S
and a molecular weight of 384.47 g/mol. Its IUPAC name is fluoroform;1-(2-phenylphenyl)naphthalene;sulfane.
Molecular Properties
| Compound Name | fluoroform;1-(2-phenylphenyl)naphthalene;sulfane |
| PubChem CID | 162622934 |
| Molecular Formula | C23H19F3S |
| Molecular Weight | 384.47 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | fluoroform;1-(2-phenylphenyl)naphthalene;sulfane |
| SMILES | FC(F)F.S.c1ccc(-c2ccccc2-c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C22H16.CHF3.H2S/c1-2-9-17(10-3-1)19-14-6-7-15-21(19)22-16-8-12-18-11-4-5-13-20(18)22;2-1(3)4;/h1-16H;1H;1H2 |
| InChIKey | OZGKJOBFUCSQLK-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.47 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze fluoroform;1-(2-phenylphenyl)naphthalene;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoroform;1-(2-phenylphenyl)naphthalene;sulfane?
The IUPAC name of fluoroform;1-(2-phenylphenyl)naphthalene;sulfane (CID 162622934) is fluoroform;1-(2-phenylphenyl)naphthalene;sulfane.
What is the SMILES notation for fluoroform;1-(2-phenylphenyl)naphthalene;sulfane?
The canonical SMILES for fluoroform;1-(2-phenylphenyl)naphthalene;sulfane is FC(F)F.S.c1ccc(-c2ccccc2-c2cccc3ccccc23)cc1.
What is the InChIKey of fluoroform;1-(2-phenylphenyl)naphthalene;sulfane?
The InChIKey is OZGKJOBFUCSQLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16.CHF3.H2S/c1-2-9-17(10-3-1)19-14-6-7-15-21(19)22-16-8-12-18-11-4-5-13-20(18)22;2-1(3)4;/h1-16H;1H;1H2.
What are the key properties of fluoroform;1-(2-phenylphenyl)naphthalene;sulfane?
fluoroform;1-(2-phenylphenyl)naphthalene;sulfane has a molecular weight of 384.47 g/mol, XLogP of 7.47, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for fluoroform;1-(2-phenylphenyl)naphthalene;sulfane is sourced from PubChem (CID 162622934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).