About (E)-N'-ethyl-4,4-difluorobut-2-enimidamide
(E)-N'-ethyl-4,4-difluorobut-2-enimidamide (PubChem CID 162622955) has the molecular formula C6H10F2N2
and a molecular weight of 148.16 g/mol. Its IUPAC name is (E)-N'-ethyl-4,4-difluorobut-2-enimidamide.
Molecular Properties
| Compound Name | (E)-N'-ethyl-4,4-difluorobut-2-enimidamide |
| PubChem CID | 162622955 |
| Molecular Formula | C6H10F2N2 |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.08 |
| IUPAC Name | (E)-N'-ethyl-4,4-difluorobut-2-enimidamide |
| SMILES | CC/N=C(N)/C=C/C(F)F |
| InChI | InChI=1S/C6H10F2N2/c1-2-10-6(9)4-3-5(7)8/h3-5H,2H2,1H3,(H2,9,10)/b4-3+ |
| InChIKey | MTKXNZOQFJBPIU-ONEGZZNKSA-N |
| XLogP | 1.18 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (E)-N'-ethyl-4,4-difluorobut-2-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N'-ethyl-4,4-difluorobut-2-enimidamide?
The IUPAC name of (E)-N'-ethyl-4,4-difluorobut-2-enimidamide (CID 162622955) is (E)-N'-ethyl-4,4-difluorobut-2-enimidamide.
What is the SMILES notation for (E)-N'-ethyl-4,4-difluorobut-2-enimidamide?
The canonical SMILES for (E)-N'-ethyl-4,4-difluorobut-2-enimidamide is CC/N=C(N)/C=C/C(F)F.
What is the InChIKey of (E)-N'-ethyl-4,4-difluorobut-2-enimidamide?
The InChIKey is MTKXNZOQFJBPIU-ONEGZZNKSA-N. The full InChI is InChI=1S/C6H10F2N2/c1-2-10-6(9)4-3-5(7)8/h3-5H,2H2,1H3,(H2,9,10)/b4-3+.
What are the key properties of (E)-N'-ethyl-4,4-difluorobut-2-enimidamide?
(E)-N'-ethyl-4,4-difluorobut-2-enimidamide has a molecular weight of 148.16 g/mol, XLogP of 1.18, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N'-ethyl-4,4-difluorobut-2-enimidamide is sourced from PubChem (CID 162622955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).