C23H31F3N6S — CID 162623086
5-[4-(1-amino-3-methyliminoprop-1-en-2-yl)-2-(trifluoromethyl)phenyl]-N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,4-thiadiazol-2-amine (PubChem CID 162623086) has the molecular formula C23H31F3N6S and a molecular weight of 480.60 g/mol. Its IUPAC name is 5-[4-(1-amino-3-methyliminoprop-1-en-2-yl)-2-(trifluoromethyl)phenyl]-N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[4-(1-amino-3-methyliminoprop-1-en-2-yl)-2-(trifluoromethyl)phenyl]-N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 162623086 |
| Molecular Formula | C23H31F3N6S |
| Molecular Weight | 480.60 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | 5-[4-(1-amino-3-methyliminoprop-1-en-2-yl)-2-(trifluoromethyl)phenyl]-N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,4-thiadiazol-2-amine |
| SMILES | C/N=C/C(=CN)c1ccc(-c2nnc(N(C)C3CC(C)(C)NC(C)(C)C3)s2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H31F3N6S/c1-21(2)10-16(11-22(3,4)31-21)32(6)20-30-29-19(33-20)17-8-7-14(15(12-27)13-28-5)9-18(17)23(24,25)26/h7-9,12-13,16,31H,10-11,27H2,1-6H3/b15-12?,28-13+ |
| InChIKey | BZXGHLFRXGHVOT-QLFLZGFISA-N |
| XLogP | 4.97 |
| TPSA | 79.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.60 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|