C19H30O4 — CID 162623218
[(1S,2R,5R,7R,8R,9S)-8-acetyloxy-2,6,6,9-tetramethyl-5-tricyclo[5.4.0.02,9]undecanyl] acetate (PubChem CID 162623218) has the molecular formula C19H30O4 and a molecular weight of 322.45 g/mol. Its IUPAC name is [(1S,2R,5R,7R,8R,9S)-8-acetyloxy-2,6,6,9-tetramethyl-5-tricyclo[5.4.0.02,9]undecanyl] acetate.
| Compound Name | [(1S,2R,5R,7R,8R,9S)-8-acetyloxy-2,6,6,9-tetramethyl-5-tricyclo[5.4.0.02,9]undecanyl] acetate |
|---|---|
| PubChem CID | 162623218 |
| Molecular Formula | C19H30O4 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | [(1S,2R,5R,7R,8R,9S)-8-acetyloxy-2,6,6,9-tetramethyl-5-tricyclo[5.4.0.02,9]undecanyl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H]2[C@@H]3CC[C@@]1(C)[C@]3(C)CC[C@@H](OC(C)=O)C2(C)C |
| InChI | InChI=1S/C19H30O4/c1-11(20)22-14-8-10-18(5)13-7-9-19(18,6)16(23-12(2)21)15(13)17(14,3)4/h13-16H,7-10H2,1-6H3/t13-,14+,15-,16+,18+,19+/m0/s1 |
| InChIKey | ICOYRZKVRTXJDJ-DNEVWPOVSA-N |
| XLogP | 3.72 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |