C22H28O3S — CID 162623225
[(1S,4S,7R)-1,7-dimethyl-7-[(1Z)-4-methylpenta-1,4-dienyl]-2-bicyclo[2.2.1]hept-2-enyl] 4-methylbenzenesulfonate (PubChem CID 162623225) has the molecular formula C22H28O3S and a molecular weight of 372.53 g/mol. Its IUPAC name is [(1S,4S,7R)-1,7-dimethyl-7-[(1Z)-4-methylpenta-1,4-dienyl]-2-bicyclo[2.2.1]hept-2-enyl] 4-methylbenzenesulfonate.
| Compound Name | [(1S,4S,7R)-1,7-dimethyl-7-[(1Z)-4-methylpenta-1,4-dienyl]-2-bicyclo[2.2.1]hept-2-enyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 162623225 |
| Molecular Formula | C22H28O3S |
| Molecular Weight | 372.53 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | [(1S,4S,7R)-1,7-dimethyl-7-[(1Z)-4-methylpenta-1,4-dienyl]-2-bicyclo[2.2.1]hept-2-enyl] 4-methylbenzenesulfonate |
| SMILES | C=C(C)C/C=C\[C@]1(C)[C@@H]2C=C(OS(=O)(=O)c3ccc(C)cc3)[C@@]1(C)CC2 |
| InChI | InChI=1S/C22H28O3S/c1-16(2)7-6-13-21(4)18-12-14-22(21,5)20(15-18)25-26(23,24)19-10-8-17(3)9-11-19/h6,8-11,13,15,18H,1,7,12,14H2,2-5H3/b13-6-/t18-,21+,22+/m0/s1 |
| InChIKey | VCIWPPKTGUXDNS-DURQVKBCSA-N |
| XLogP | 5.54 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.53 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|