About 4-[(3R)-1,1-difluoro-5-(4-phenylmethoxyphenyl)pent-1-en-3-yl]sulfanylaniline
4-[(3R)-1,1-difluoro-5-(4-phenylmethoxyphenyl)pent-1-en-3-yl]sulfanylaniline (PubChem CID 162623278) has the molecular formula C24H23F2NOS
and a molecular weight of 411.52 g/mol. Its IUPAC name is 4-[(3R)-1,1-difluoro-5-(4-phenylmethoxyphenyl)pent-1-en-3-yl]sulfanylaniline.
Molecular Properties
| Compound Name | 4-[(3R)-1,1-difluoro-5-(4-phenylmethoxyphenyl)pent-1-en-3-yl]sulfanylaniline |
| PubChem CID | 162623278 |
| Molecular Formula | C24H23F2NOS |
| Molecular Weight | 411.52 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 4-[(3R)-1,1-difluoro-5-(4-phenylmethoxyphenyl)pent-1-en-3-yl]sulfanylaniline |
| SMILES | Nc1ccc(S[C@@H](C=C(F)F)CCc2ccc(OCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C24H23F2NOS/c25-24(26)16-23(29-22-14-9-20(27)10-15-22)13-8-18-6-11-21(12-7-18)28-17-19-4-2-1-3-5-19/h1-7,9-12,14-16,23H,8,13,17,27H2/t23-/m1/s1 |
| InChIKey | POYGJECDZPBFMW-HSZRJFAPSA-N |
| XLogP | 6.72 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 411.52 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-[(3R)-1,1-difluoro-5-(4-phenylmethoxyphenyl)pent-1-en-3-yl]sulfanylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3R)-1,1-difluoro-5-(4-phenylmethoxyphenyl)pent-1-en-3-yl]sulfanylaniline?
The IUPAC name of 4-[(3R)-1,1-difluoro-5-(4-phenylmethoxyphenyl)pent-1-en-3-yl]sulfanylaniline (CID 162623278) is 4-[(3R)-1,1-difluoro-5-(4-phenylmethoxyphenyl)pent-1-en-3-yl]sulfanylaniline.
What is the SMILES notation for 4-[(3R)-1,1-difluoro-5-(4-phenylmethoxyphenyl)pent-1-en-3-yl]sulfanylaniline?
The canonical SMILES for 4-[(3R)-1,1-difluoro-5-(4-phenylmethoxyphenyl)pent-1-en-3-yl]sulfanylaniline is Nc1ccc(S[C@@H](C=C(F)F)CCc2ccc(OCc3ccccc3)cc2)cc1.
What is the InChIKey of 4-[(3R)-1,1-difluoro-5-(4-phenylmethoxyphenyl)pent-1-en-3-yl]sulfanylaniline?
The InChIKey is POYGJECDZPBFMW-HSZRJFAPSA-N. The full InChI is InChI=1S/C24H23F2NOS/c25-24(26)16-23(29-22-14-9-20(27)10-15-22)13-8-18-6-11-21(12-7-18)28-17-19-4-2-1-3-5-19/h1-7,9-12,14-16,23H,8,13,17,27H2/t23-/m1/s1.
What are the key properties of 4-[(3R)-1,1-difluoro-5-(4-phenylmethoxyphenyl)pent-1-en-3-yl]sulfanylaniline?
4-[(3R)-1,1-difluoro-5-(4-phenylmethoxyphenyl)pent-1-en-3-yl]sulfanylaniline has a molecular weight of 411.52 g/mol, XLogP of 6.72, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3R)-1,1-difluoro-5-(4-phenylmethoxyphenyl)pent-1-en-3-yl]sulfanylaniline is sourced from PubChem (CID 162623278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).