C18H18F2O3S — CID 162623283
1-[(Z)-1,1-difluoro-5-phenylpent-2-en-2-yl]sulfonyl-4-methoxybenzene (PubChem CID 162623283) has the molecular formula C18H18F2O3S and a molecular weight of 352.40 g/mol. Its IUPAC name is 1-[(Z)-1,1-difluoro-5-phenylpent-2-en-2-yl]sulfonyl-4-methoxybenzene.
| Compound Name | 1-[(Z)-1,1-difluoro-5-phenylpent-2-en-2-yl]sulfonyl-4-methoxybenzene |
|---|---|
| PubChem CID | 162623283 |
| Molecular Formula | C18H18F2O3S |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 1-[(Z)-1,1-difluoro-5-phenylpent-2-en-2-yl]sulfonyl-4-methoxybenzene |
| SMILES | COc1ccc(S(=O)(=O)/C(=C\CCc2ccccc2)C(F)F)cc1 |
| InChI | InChI=1S/C18H18F2O3S/c1-23-15-10-12-16(13-11-15)24(21,22)17(18(19)20)9-5-8-14-6-3-2-4-7-14/h2-4,6-7,9-13,18H,5,8H2,1H3/b17-9- |
| InChIKey | XYIYJXMCQOXSFN-MFOYZWKCSA-N |
| XLogP | 4.25 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |