C12H18F2 — CID 162623291
(5R)-1,1-difluoro-5,9-dimethyldeca-1,2,8-triene (PubChem CID 162623291) has the molecular formula C12H18F2 and a molecular weight of 200.27 g/mol. Its IUPAC name is (5R)-1,1-difluoro-5,9-dimethyldeca-1,2,8-triene.
| Compound Name | (5R)-1,1-difluoro-5,9-dimethyldeca-1,2,8-triene |
|---|---|
| PubChem CID | 162623291 |
| Molecular Formula | C12H18F2 |
| Molecular Weight | 200.27 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | (5R)-1,1-difluoro-5,9-dimethyldeca-1,2,8-triene |
| SMILES | CC(C)=CCC[C@@H](C)CC=C=C(F)F |
| InChI | InChI=1S/C12H18F2/c1-10(2)6-4-7-11(3)8-5-9-12(13)14/h5-6,11H,4,7-8H2,1-3H3/t11-/m1/s1 |
| InChIKey | HKIXHYXOEPLMRE-LLVKDONJSA-N |
| XLogP | 4.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.27 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|