About methyl 2-[(Z)-5,5-difluoro-4-(4-methoxyphenyl)sulfanylpent-3-enyl]benzoate
methyl 2-[(Z)-5,5-difluoro-4-(4-methoxyphenyl)sulfanylpent-3-enyl]benzoate (PubChem CID 162623294) has the molecular formula C20H20F2O3S
and a molecular weight of 378.44 g/mol. Its IUPAC name is methyl 2-[(Z)-5,5-difluoro-4-(4-methoxyphenyl)sulfanylpent-3-enyl]benzoate.
Molecular Properties
| Compound Name | methyl 2-[(Z)-5,5-difluoro-4-(4-methoxyphenyl)sulfanylpent-3-enyl]benzoate |
| PubChem CID | 162623294 |
| Molecular Formula | C20H20F2O3S |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | methyl 2-[(Z)-5,5-difluoro-4-(4-methoxyphenyl)sulfanylpent-3-enyl]benzoate |
| SMILES | COC(=O)c1ccccc1CC/C=C(\Sc1ccc(OC)cc1)C(F)F |
| InChI | InChI=1S/C20H20F2O3S/c1-24-15-10-12-16(13-11-15)26-18(19(21)22)9-5-7-14-6-3-4-8-17(14)20(23)25-2/h3-4,6,8-13,19H,5,7H2,1-2H3/b18-9- |
| InChIKey | IKPRIBRSUNNPLC-NVMNQCDNSA-N |
| XLogP | 5.36 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-[(Z)-5,5-difluoro-4-(4-methoxyphenyl)sulfanylpent-3-enyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(Z)-5,5-difluoro-4-(4-methoxyphenyl)sulfanylpent-3-enyl]benzoate?
The IUPAC name of methyl 2-[(Z)-5,5-difluoro-4-(4-methoxyphenyl)sulfanylpent-3-enyl]benzoate (CID 162623294) is methyl 2-[(Z)-5,5-difluoro-4-(4-methoxyphenyl)sulfanylpent-3-enyl]benzoate.
What is the SMILES notation for methyl 2-[(Z)-5,5-difluoro-4-(4-methoxyphenyl)sulfanylpent-3-enyl]benzoate?
The canonical SMILES for methyl 2-[(Z)-5,5-difluoro-4-(4-methoxyphenyl)sulfanylpent-3-enyl]benzoate is COC(=O)c1ccccc1CC/C=C(\Sc1ccc(OC)cc1)C(F)F.
What is the InChIKey of methyl 2-[(Z)-5,5-difluoro-4-(4-methoxyphenyl)sulfanylpent-3-enyl]benzoate?
The InChIKey is IKPRIBRSUNNPLC-NVMNQCDNSA-N. The full InChI is InChI=1S/C20H20F2O3S/c1-24-15-10-12-16(13-11-15)26-18(19(21)22)9-5-7-14-6-3-4-8-17(14)20(23)25-2/h3-4,6,8-13,19H,5,7H2,1-2H3/b18-9-.
What are the key properties of methyl 2-[(Z)-5,5-difluoro-4-(4-methoxyphenyl)sulfanylpent-3-enyl]benzoate?
methyl 2-[(Z)-5,5-difluoro-4-(4-methoxyphenyl)sulfanylpent-3-enyl]benzoate has a molecular weight of 378.44 g/mol, XLogP of 5.36, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(Z)-5,5-difluoro-4-(4-methoxyphenyl)sulfanylpent-3-enyl]benzoate is sourced from PubChem (CID 162623294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).