About 4-[(3R)-1,1-difluoro-5-(4-phenylmethoxyphenyl)pent-1-en-3-yl]sulfanylphenol
4-[(3R)-1,1-difluoro-5-(4-phenylmethoxyphenyl)pent-1-en-3-yl]sulfanylphenol (PubChem CID 162623305) has the molecular formula C24H22F2O2S
and a molecular weight of 412.50 g/mol. Its IUPAC name is 4-[(3R)-1,1-difluoro-5-(4-phenylmethoxyphenyl)pent-1-en-3-yl]sulfanylphenol.
Molecular Properties
| Compound Name | 4-[(3R)-1,1-difluoro-5-(4-phenylmethoxyphenyl)pent-1-en-3-yl]sulfanylphenol |
| PubChem CID | 162623305 |
| Molecular Formula | C24H22F2O2S |
| Molecular Weight | 412.50 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | 4-[(3R)-1,1-difluoro-5-(4-phenylmethoxyphenyl)pent-1-en-3-yl]sulfanylphenol |
| SMILES | Oc1ccc(SC(C=C(F)F)CCc2ccc(OCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C24H22F2O2S/c25-24(26)16-23(29-22-14-9-20(27)10-15-22)13-8-18-6-11-21(12-7-18)28-17-19-4-2-1-3-5-19/h1-7,9-12,14-16,23,27H,8,13,17H2 |
| InChIKey | XFJBSJVXCQGYEP-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.50 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[(3R)-1,1-difluoro-5-(4-phenylmethoxyphenyl)pent-1-en-3-yl]sulfanylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3R)-1,1-difluoro-5-(4-phenylmethoxyphenyl)pent-1-en-3-yl]sulfanylphenol?
The IUPAC name of 4-[(3R)-1,1-difluoro-5-(4-phenylmethoxyphenyl)pent-1-en-3-yl]sulfanylphenol (CID 162623305) is 4-[(3R)-1,1-difluoro-5-(4-phenylmethoxyphenyl)pent-1-en-3-yl]sulfanylphenol.
What is the SMILES notation for 4-[(3R)-1,1-difluoro-5-(4-phenylmethoxyphenyl)pent-1-en-3-yl]sulfanylphenol?
The canonical SMILES for 4-[(3R)-1,1-difluoro-5-(4-phenylmethoxyphenyl)pent-1-en-3-yl]sulfanylphenol is Oc1ccc(SC(C=C(F)F)CCc2ccc(OCc3ccccc3)cc2)cc1.
What is the InChIKey of 4-[(3R)-1,1-difluoro-5-(4-phenylmethoxyphenyl)pent-1-en-3-yl]sulfanylphenol?
The InChIKey is XFJBSJVXCQGYEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22F2O2S/c25-24(26)16-23(29-22-14-9-20(27)10-15-22)13-8-18-6-11-21(12-7-18)28-17-19-4-2-1-3-5-19/h1-7,9-12,14-16,23,27H,8,13,17H2.
What are the key properties of 4-[(3R)-1,1-difluoro-5-(4-phenylmethoxyphenyl)pent-1-en-3-yl]sulfanylphenol?
4-[(3R)-1,1-difluoro-5-(4-phenylmethoxyphenyl)pent-1-en-3-yl]sulfanylphenol has a molecular weight of 412.50 g/mol, XLogP of 6.85, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3R)-1,1-difluoro-5-(4-phenylmethoxyphenyl)pent-1-en-3-yl]sulfanylphenol is sourced from PubChem (CID 162623305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).