About 1-[(Z)-5,5-difluoro-4-(4-methoxyphenyl)sulfanylpent-3-enyl]-4-phenylmethoxybenzene
1-[(Z)-5,5-difluoro-4-(4-methoxyphenyl)sulfanylpent-3-enyl]-4-phenylmethoxybenzene (PubChem CID 162623307) has the molecular formula C25H24F2O2S
and a molecular weight of 426.53 g/mol. Its IUPAC name is 1-[(Z)-5,5-difluoro-4-(4-methoxyphenyl)sulfanylpent-3-enyl]-4-phenylmethoxybenzene.
Molecular Properties
| Compound Name | 1-[(Z)-5,5-difluoro-4-(4-methoxyphenyl)sulfanylpent-3-enyl]-4-phenylmethoxybenzene |
| PubChem CID | 162623307 |
| Molecular Formula | C25H24F2O2S |
| Molecular Weight | 426.53 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | 1-[(Z)-5,5-difluoro-4-(4-methoxyphenyl)sulfanylpent-3-enyl]-4-phenylmethoxybenzene |
| SMILES | COc1ccc(S/C(=C\CCc2ccc(OCc3ccccc3)cc2)C(F)F)cc1 |
| InChI | InChI=1S/C25H24F2O2S/c1-28-21-14-16-23(17-15-21)30-24(25(26)27)9-5-8-19-10-12-22(13-11-19)29-18-20-6-3-2-4-7-20/h2-4,6-7,9-17,25H,5,8,18H2,1H3/b24-9- |
| InChIKey | XCZDMSMZUVTUDL-OPVMPGTRSA-N |
| XLogP | 7.15 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.53 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(Z)-5,5-difluoro-4-(4-methoxyphenyl)sulfanylpent-3-enyl]-4-phenylmethoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(Z)-5,5-difluoro-4-(4-methoxyphenyl)sulfanylpent-3-enyl]-4-phenylmethoxybenzene?
The IUPAC name of 1-[(Z)-5,5-difluoro-4-(4-methoxyphenyl)sulfanylpent-3-enyl]-4-phenylmethoxybenzene (CID 162623307) is 1-[(Z)-5,5-difluoro-4-(4-methoxyphenyl)sulfanylpent-3-enyl]-4-phenylmethoxybenzene.
What is the SMILES notation for 1-[(Z)-5,5-difluoro-4-(4-methoxyphenyl)sulfanylpent-3-enyl]-4-phenylmethoxybenzene?
The canonical SMILES for 1-[(Z)-5,5-difluoro-4-(4-methoxyphenyl)sulfanylpent-3-enyl]-4-phenylmethoxybenzene is COc1ccc(S/C(=C\CCc2ccc(OCc3ccccc3)cc2)C(F)F)cc1.
What is the InChIKey of 1-[(Z)-5,5-difluoro-4-(4-methoxyphenyl)sulfanylpent-3-enyl]-4-phenylmethoxybenzene?
The InChIKey is XCZDMSMZUVTUDL-OPVMPGTRSA-N. The full InChI is InChI=1S/C25H24F2O2S/c1-28-21-14-16-23(17-15-21)30-24(25(26)27)9-5-8-19-10-12-22(13-11-19)29-18-20-6-3-2-4-7-20/h2-4,6-7,9-17,25H,5,8,18H2,1H3/b24-9-.
What are the key properties of 1-[(Z)-5,5-difluoro-4-(4-methoxyphenyl)sulfanylpent-3-enyl]-4-phenylmethoxybenzene?
1-[(Z)-5,5-difluoro-4-(4-methoxyphenyl)sulfanylpent-3-enyl]-4-phenylmethoxybenzene has a molecular weight of 426.53 g/mol, XLogP of 7.15, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(Z)-5,5-difluoro-4-(4-methoxyphenyl)sulfanylpent-3-enyl]-4-phenylmethoxybenzene is sourced from PubChem (CID 162623307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).