About 1-[(3R)-5,5-difluoro-3-(4-fluorophenyl)sulfanylpent-4-enyl]-4-phenylmethoxybenzene
1-[(3R)-5,5-difluoro-3-(4-fluorophenyl)sulfanylpent-4-enyl]-4-phenylmethoxybenzene (PubChem CID 162623310) has the molecular formula C24H21F3OS
and a molecular weight of 414.49 g/mol. Its IUPAC name is 1-[(3R)-5,5-difluoro-3-(4-fluorophenyl)sulfanylpent-4-enyl]-4-phenylmethoxybenzene.
Molecular Properties
| Compound Name | 1-[(3R)-5,5-difluoro-3-(4-fluorophenyl)sulfanylpent-4-enyl]-4-phenylmethoxybenzene |
| PubChem CID | 162623310 |
| Molecular Formula | C24H21F3OS |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | 1-[(3R)-5,5-difluoro-3-(4-fluorophenyl)sulfanylpent-4-enyl]-4-phenylmethoxybenzene |
| SMILES | FC(F)=CC(CCc1ccc(OCc2ccccc2)cc1)Sc1ccc(F)cc1 |
| InChI | InChI=1S/C24H21F3OS/c25-20-9-14-22(15-10-20)29-23(16-24(26)27)13-8-18-6-11-21(12-7-18)28-17-19-4-2-1-3-5-19/h1-7,9-12,14-16,23H,8,13,17H2 |
| InChIKey | QAPZDDZXANOWLD-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(3R)-5,5-difluoro-3-(4-fluorophenyl)sulfanylpent-4-enyl]-4-phenylmethoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3R)-5,5-difluoro-3-(4-fluorophenyl)sulfanylpent-4-enyl]-4-phenylmethoxybenzene?
The IUPAC name of 1-[(3R)-5,5-difluoro-3-(4-fluorophenyl)sulfanylpent-4-enyl]-4-phenylmethoxybenzene (CID 162623310) is 1-[(3R)-5,5-difluoro-3-(4-fluorophenyl)sulfanylpent-4-enyl]-4-phenylmethoxybenzene.
What is the SMILES notation for 1-[(3R)-5,5-difluoro-3-(4-fluorophenyl)sulfanylpent-4-enyl]-4-phenylmethoxybenzene?
The canonical SMILES for 1-[(3R)-5,5-difluoro-3-(4-fluorophenyl)sulfanylpent-4-enyl]-4-phenylmethoxybenzene is FC(F)=CC(CCc1ccc(OCc2ccccc2)cc1)Sc1ccc(F)cc1.
What is the InChIKey of 1-[(3R)-5,5-difluoro-3-(4-fluorophenyl)sulfanylpent-4-enyl]-4-phenylmethoxybenzene?
The InChIKey is QAPZDDZXANOWLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H21F3OS/c25-20-9-14-22(15-10-20)29-23(16-24(26)27)13-8-18-6-11-21(12-7-18)28-17-19-4-2-1-3-5-19/h1-7,9-12,14-16,23H,8,13,17H2.
What are the key properties of 1-[(3R)-5,5-difluoro-3-(4-fluorophenyl)sulfanylpent-4-enyl]-4-phenylmethoxybenzene?
1-[(3R)-5,5-difluoro-3-(4-fluorophenyl)sulfanylpent-4-enyl]-4-phenylmethoxybenzene has a molecular weight of 414.49 g/mol, XLogP of 7.28, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3R)-5,5-difluoro-3-(4-fluorophenyl)sulfanylpent-4-enyl]-4-phenylmethoxybenzene is sourced from PubChem (CID 162623310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).