About 1-chloro-4-[(Z)-1,1-difluoro-5-(4-phenylmethoxyphenyl)pent-2-en-2-yl]sulfanylbenzene
1-chloro-4-[(Z)-1,1-difluoro-5-(4-phenylmethoxyphenyl)pent-2-en-2-yl]sulfanylbenzene (PubChem CID 162623314) has the molecular formula C24H21ClF2OS
and a molecular weight of 430.95 g/mol. Its IUPAC name is 1-chloro-4-[(Z)-1,1-difluoro-5-(4-phenylmethoxyphenyl)pent-2-en-2-yl]sulfanylbenzene.
Molecular Properties
| Compound Name | 1-chloro-4-[(Z)-1,1-difluoro-5-(4-phenylmethoxyphenyl)pent-2-en-2-yl]sulfanylbenzene |
| PubChem CID | 162623314 |
| Molecular Formula | C24H21ClF2OS |
| Molecular Weight | 430.95 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | 1-chloro-4-[(Z)-1,1-difluoro-5-(4-phenylmethoxyphenyl)pent-2-en-2-yl]sulfanylbenzene |
| SMILES | FC(F)/C(=C/CCc1ccc(OCc2ccccc2)cc1)Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H21ClF2OS/c25-20-11-15-22(16-12-20)29-23(24(26)27)8-4-7-18-9-13-21(14-10-18)28-17-19-5-2-1-3-6-19/h1-3,5-6,8-16,24H,4,7,17H2/b23-8- |
| InChIKey | NMFZNKXVJXDGKM-NYAPKIOYSA-N |
| XLogP | 7.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 430.95 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-chloro-4-[(Z)-1,1-difluoro-5-(4-phenylmethoxyphenyl)pent-2-en-2-yl]sulfanylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-4-[(Z)-1,1-difluoro-5-(4-phenylmethoxyphenyl)pent-2-en-2-yl]sulfanylbenzene?
The IUPAC name of 1-chloro-4-[(Z)-1,1-difluoro-5-(4-phenylmethoxyphenyl)pent-2-en-2-yl]sulfanylbenzene (CID 162623314) is 1-chloro-4-[(Z)-1,1-difluoro-5-(4-phenylmethoxyphenyl)pent-2-en-2-yl]sulfanylbenzene.
What is the SMILES notation for 1-chloro-4-[(Z)-1,1-difluoro-5-(4-phenylmethoxyphenyl)pent-2-en-2-yl]sulfanylbenzene?
The canonical SMILES for 1-chloro-4-[(Z)-1,1-difluoro-5-(4-phenylmethoxyphenyl)pent-2-en-2-yl]sulfanylbenzene is FC(F)/C(=C/CCc1ccc(OCc2ccccc2)cc1)Sc1ccc(Cl)cc1.
What is the InChIKey of 1-chloro-4-[(Z)-1,1-difluoro-5-(4-phenylmethoxyphenyl)pent-2-en-2-yl]sulfanylbenzene?
The InChIKey is NMFZNKXVJXDGKM-NYAPKIOYSA-N. The full InChI is InChI=1S/C24H21ClF2OS/c25-20-11-15-22(16-12-20)29-23(24(26)27)8-4-7-18-9-13-21(14-10-18)28-17-19-5-2-1-3-6-19/h1-3,5-6,8-16,24H,4,7,17H2/b23-8-.
What are the key properties of 1-chloro-4-[(Z)-1,1-difluoro-5-(4-phenylmethoxyphenyl)pent-2-en-2-yl]sulfanylbenzene?
1-chloro-4-[(Z)-1,1-difluoro-5-(4-phenylmethoxyphenyl)pent-2-en-2-yl]sulfanylbenzene has a molecular weight of 430.95 g/mol, XLogP of 7.79, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-4-[(Z)-1,1-difluoro-5-(4-phenylmethoxyphenyl)pent-2-en-2-yl]sulfanylbenzene is sourced from PubChem (CID 162623314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).