About methyl 3-[(3R)-1,1-difluoro-5-(4-phenylmethoxyphenyl)pent-1-en-3-yl]sulfanylpropanoate
methyl 3-[(3R)-1,1-difluoro-5-(4-phenylmethoxyphenyl)pent-1-en-3-yl]sulfanylpropanoate (PubChem CID 162623355) has the molecular formula C22H24F2O3S
and a molecular weight of 406.49 g/mol. Its IUPAC name is methyl 3-[(3R)-1,1-difluoro-5-(4-phenylmethoxyphenyl)pent-1-en-3-yl]sulfanylpropanoate.
Molecular Properties
| Compound Name | methyl 3-[(3R)-1,1-difluoro-5-(4-phenylmethoxyphenyl)pent-1-en-3-yl]sulfanylpropanoate |
| PubChem CID | 162623355 |
| Molecular Formula | C22H24F2O3S |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | methyl 3-[(3R)-1,1-difluoro-5-(4-phenylmethoxyphenyl)pent-1-en-3-yl]sulfanylpropanoate |
| SMILES | COC(=O)CCS[C@@H](C=C(F)F)CCc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C22H24F2O3S/c1-26-22(25)13-14-28-20(15-21(23)24)12-9-17-7-10-19(11-8-17)27-16-18-5-3-2-4-6-18/h2-8,10-11,15,20H,9,12-14,16H2,1H3/t20-/m1/s1 |
| InChIKey | BVOXZNFMGDWFDG-HXUWFJFHSA-N |
| XLogP | 5.64 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 3-[(3R)-1,1-difluoro-5-(4-phenylmethoxyphenyl)pent-1-en-3-yl]sulfanylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[(3R)-1,1-difluoro-5-(4-phenylmethoxyphenyl)pent-1-en-3-yl]sulfanylpropanoate?
The IUPAC name of methyl 3-[(3R)-1,1-difluoro-5-(4-phenylmethoxyphenyl)pent-1-en-3-yl]sulfanylpropanoate (CID 162623355) is methyl 3-[(3R)-1,1-difluoro-5-(4-phenylmethoxyphenyl)pent-1-en-3-yl]sulfanylpropanoate.
What is the SMILES notation for methyl 3-[(3R)-1,1-difluoro-5-(4-phenylmethoxyphenyl)pent-1-en-3-yl]sulfanylpropanoate?
The canonical SMILES for methyl 3-[(3R)-1,1-difluoro-5-(4-phenylmethoxyphenyl)pent-1-en-3-yl]sulfanylpropanoate is COC(=O)CCS[C@@H](C=C(F)F)CCc1ccc(OCc2ccccc2)cc1.
What is the InChIKey of methyl 3-[(3R)-1,1-difluoro-5-(4-phenylmethoxyphenyl)pent-1-en-3-yl]sulfanylpropanoate?
The InChIKey is BVOXZNFMGDWFDG-HXUWFJFHSA-N. The full InChI is InChI=1S/C22H24F2O3S/c1-26-22(25)13-14-28-20(15-21(23)24)12-9-17-7-10-19(11-8-17)27-16-18-5-3-2-4-6-18/h2-8,10-11,15,20H,9,12-14,16H2,1H3/t20-/m1/s1.
What are the key properties of methyl 3-[(3R)-1,1-difluoro-5-(4-phenylmethoxyphenyl)pent-1-en-3-yl]sulfanylpropanoate?
methyl 3-[(3R)-1,1-difluoro-5-(4-phenylmethoxyphenyl)pent-1-en-3-yl]sulfanylpropanoate has a molecular weight of 406.49 g/mol, XLogP of 5.64, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[(3R)-1,1-difluoro-5-(4-phenylmethoxyphenyl)pent-1-en-3-yl]sulfanylpropanoate is sourced from PubChem (CID 162623355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).