C24H17ClF3N7O2 — CID 162623517
6-[(6-chloro-2-methylindazol-5-yl)amino]-3-(5-methyl-3-pyridinyl)-1-[(3,4,5-trifluorophenyl)methyl]-1,3,5-triazine-2,4-dione (PubChem CID 162623517) has the molecular formula C24H17ClF3N7O2 and a molecular weight of 527.89 g/mol. Its IUPAC name is 6-[(6-chloro-2-methylindazol-5-yl)amino]-3-(5-methyl-3-pyridinyl)-1-[(3,4,5-trifluorophenyl)methyl]-1,3,5-triazine-2,4-dione.
| Compound Name | 6-[(6-chloro-2-methylindazol-5-yl)amino]-3-(5-methyl-3-pyridinyl)-1-[(3,4,5-trifluorophenyl)methyl]-1,3,5-triazine-2,4-dione |
|---|---|
| PubChem CID | 162623517 |
| Molecular Formula | C24H17ClF3N7O2 |
| Molecular Weight | 527.89 g/mol |
| Exact Mass | 527.11 |
| IUPAC Name | 6-[(6-chloro-2-methylindazol-5-yl)amino]-3-(5-methyl-3-pyridinyl)-1-[(3,4,5-trifluorophenyl)methyl]-1,3,5-triazine-2,4-dione |
| SMILES | Cc1cncc(-n2c(=O)nc(Nc3cc4cn(C)nc4cc3Cl)n(Cc3cc(F)c(F)c(F)c3)c2=O)c1 |
| InChI | InChI=1S/C24H17ClF3N7O2/c1-12-3-15(9-29-8-12)35-23(36)31-22(30-20-6-14-11-33(2)32-19(14)7-16(20)25)34(24(35)37)10-13-4-17(26)21(28)18(27)5-13/h3-9,11H,10H2,1-2H3,(H,30,31,36) |
| InChIKey | FTIFIZZEWIBTMR-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 99.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.89 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|