C33H33F3N6O — CID 162624203
(2R,6S)-2,6-dimethyl-4-[[4-[(E)-2-[7-[5-(trifluoromethyl)-1H-pyrazol-4-yl]-8,9,10,11-tetrahydro-3H-pyrazolo[4,3-a]phenanthridin-1-yl]ethenyl]phenyl]methyl]morpholine (PubChem CID 162624203) has the molecular formula C33H33F3N6O and a molecular weight of 586.66 g/mol. Its IUPAC name is (2R,6S)-2,6-dimethyl-4-[[4-[(E)-2-[7-[5-(trifluoromethyl)-1H-pyrazol-4-yl]-8,9,10,11-tetrahydro-3H-pyrazolo[4,3-a]phenanthridin-1-yl]ethenyl]phenyl]methyl]morpholine.
| Compound Name | (2R,6S)-2,6-dimethyl-4-[[4-[(E)-2-[7-[5-(trifluoromethyl)-1H-pyrazol-4-yl]-8,9,10,11-tetrahydro-3H-pyrazolo[4,3-a]phenanthridin-1-yl]ethenyl]phenyl]methyl]morpholine |
|---|---|
| PubChem CID | 162624203 |
| Molecular Formula | C33H33F3N6O |
| Molecular Weight | 586.66 g/mol |
| Exact Mass | 586.27 |
| IUPAC Name | (2R,6S)-2,6-dimethyl-4-[[4-[(E)-2-[7-[5-(trifluoromethyl)-1H-pyrazol-4-yl]-8,9,10,11-tetrahydro-3H-pyrazolo[4,3-a]phenanthridin-1-yl]ethenyl]phenyl]methyl]morpholine |
| SMILES | C[C@@H]1CN(Cc2ccc(/C=C/c3n[nH]c4ccc5nc(-c6cn[nH]c6C(F)(F)F)c6c(c5c34)CCCC6)cc2)C[C@H](C)O1 |
| InChI | InChI=1S/C33H33F3N6O/c1-19-16-42(17-20(2)43-19)18-22-9-7-21(8-10-22)11-12-27-30-28(40-39-27)14-13-26-29(30)23-5-3-4-6-24(23)31(38-26)25-15-37-41-32(25)33(34,35)36/h7-15,19-20H,3-6,16-18H2,1-2H3,(H,37,41)(H,39,40)/b12-11+/t19-,20+ |
| InChIKey | JLPFNFUWMPLWCG-APMBYPPYSA-N |
| XLogP | 7.18 |
| TPSA | 82.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.66 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |